| 1 | /* |
|---|
| 2 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 3 | % % |
|---|
| 4 | % % |
|---|
| 5 | % % |
|---|
| 6 | % RRRR EEEEE SSSSS IIIII ZZZZZ EEEEE % |
|---|
| 7 | % R R E SS I ZZ E % |
|---|
| 8 | % RRRR EEE SSS I ZZZ EEE % |
|---|
| 9 | % R R E SS I ZZ E % |
|---|
| 10 | % R R EEEEE SSSSS IIIII ZZZZZ EEEEE % |
|---|
| 11 | % % |
|---|
| 12 | % % |
|---|
| 13 | % MagickCore Image Resize Methods % |
|---|
| 14 | % % |
|---|
| 15 | % Software Design % |
|---|
| 16 | % John Cristy % |
|---|
| 17 | % July 1992 % |
|---|
| 18 | % % |
|---|
| 19 | % % |
|---|
| 20 | % Copyright 1999-2012 ImageMagick Studio LLC, a non-profit organization % |
|---|
| 21 | % dedicated to making software imaging solutions freely available. % |
|---|
| 22 | % % |
|---|
| 23 | % You may not use this file except in compliance with the License. You may % |
|---|
| 24 | % obtain a copy of the License at % |
|---|
| 25 | % % |
|---|
| 26 | % http://www.imagemagick.org/script/license.php % |
|---|
| 27 | % % |
|---|
| 28 | % Unless required by applicable law or agreed to in writing, software % |
|---|
| 29 | % distributed under the License is distributed on an "AS IS" BASIS, % |
|---|
| 30 | % WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. % |
|---|
| 31 | % See the License for the specific language governing permissions and % |
|---|
| 32 | % limitations under the License. % |
|---|
| 33 | % % |
|---|
| 34 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 35 | % |
|---|
| 36 | % |
|---|
| 37 | */ |
|---|
| 38 | |
|---|
| 39 | /* |
|---|
| 40 | Include declarations. |
|---|
| 41 | */ |
|---|
| 42 | #include "MagickCore/studio.h" |
|---|
| 43 | #include "MagickCore/artifact.h" |
|---|
| 44 | #include "MagickCore/blob.h" |
|---|
| 45 | #include "MagickCore/cache.h" |
|---|
| 46 | #include "MagickCore/cache-view.h" |
|---|
| 47 | #include "MagickCore/color.h" |
|---|
| 48 | #include "MagickCore/color-private.h" |
|---|
| 49 | #include "MagickCore/draw.h" |
|---|
| 50 | #include "MagickCore/exception.h" |
|---|
| 51 | #include "MagickCore/exception-private.h" |
|---|
| 52 | #include "MagickCore/gem.h" |
|---|
| 53 | #include "MagickCore/image.h" |
|---|
| 54 | #include "MagickCore/image-private.h" |
|---|
| 55 | #include "MagickCore/list.h" |
|---|
| 56 | #include "MagickCore/memory_.h" |
|---|
| 57 | #include "MagickCore/magick.h" |
|---|
| 58 | #include "MagickCore/pixel-accessor.h" |
|---|
| 59 | #include "MagickCore/property.h" |
|---|
| 60 | #include "MagickCore/monitor.h" |
|---|
| 61 | #include "MagickCore/monitor-private.h" |
|---|
| 62 | #include "MagickCore/option.h" |
|---|
| 63 | #include "MagickCore/pixel.h" |
|---|
| 64 | #include "MagickCore/quantum-private.h" |
|---|
| 65 | #include "MagickCore/resample.h" |
|---|
| 66 | #include "MagickCore/resample-private.h" |
|---|
| 67 | #include "MagickCore/resize.h" |
|---|
| 68 | #include "MagickCore/resize-private.h" |
|---|
| 69 | #include "MagickCore/resource_.h" |
|---|
| 70 | #include "MagickCore/string_.h" |
|---|
| 71 | #include "MagickCore/string-private.h" |
|---|
| 72 | #include "MagickCore/thread-private.h" |
|---|
| 73 | #include "MagickCore/token.h" |
|---|
| 74 | #include "MagickCore/utility.h" |
|---|
| 75 | #include "MagickCore/utility-private.h" |
|---|
| 76 | #include "MagickCore/version.h" |
|---|
| 77 | #if defined(MAGICKCORE_LQR_DELEGATE) |
|---|
| 78 | #include <lqr.h> |
|---|
| 79 | #endif |
|---|
| 80 | |
|---|
| 81 | /* |
|---|
| 82 | Typedef declarations. |
|---|
| 83 | */ |
|---|
| 84 | struct _ResizeFilter |
|---|
| 85 | { |
|---|
| 86 | MagickRealType |
|---|
| 87 | (*filter)(const MagickRealType,const ResizeFilter *), |
|---|
| 88 | (*window)(const MagickRealType,const ResizeFilter *), |
|---|
| 89 | support, /* filter region of support - the filter support limit */ |
|---|
| 90 | window_support, /* window support, usally equal to support (expert only) */ |
|---|
| 91 | scale, /* dimension scaling to fit window support (usally 1.0) */ |
|---|
| 92 | blur, /* x-scale (blur-sharpen) */ |
|---|
| 93 | coefficient[7]; /* cubic coefficents for BC-cubic spline filters */ |
|---|
| 94 | |
|---|
| 95 | size_t |
|---|
| 96 | signature; |
|---|
| 97 | }; |
|---|
| 98 | |
|---|
| 99 | /* |
|---|
| 100 | Forward declaractions. |
|---|
| 101 | */ |
|---|
| 102 | static MagickRealType |
|---|
| 103 | I0(MagickRealType x), |
|---|
| 104 | BesselOrderOne(MagickRealType), |
|---|
| 105 | Sinc(const MagickRealType, const ResizeFilter *), |
|---|
| 106 | SincFast(const MagickRealType, const ResizeFilter *); |
|---|
| 107 | |
|---|
| 108 | /* |
|---|
| 109 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 110 | % % |
|---|
| 111 | % % |
|---|
| 112 | % % |
|---|
| 113 | + F i l t e r F u n c t i o n s % |
|---|
| 114 | % % |
|---|
| 115 | % % |
|---|
| 116 | % % |
|---|
| 117 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 118 | % |
|---|
| 119 | % These are the various filter and windowing functions that are provided. |
|---|
| 120 | % |
|---|
| 121 | % They are internal to this module only. See AcquireResizeFilterInfo() for |
|---|
| 122 | % details of the access to these functions, via the GetResizeFilterSupport() |
|---|
| 123 | % and GetResizeFilterWeight() API interface. |
|---|
| 124 | % |
|---|
| 125 | % The individual filter functions have this format... |
|---|
| 126 | % |
|---|
| 127 | % static MagickRealtype *FilterName(const MagickRealType x, |
|---|
| 128 | % const MagickRealType support) |
|---|
| 129 | % |
|---|
| 130 | % A description of each parameter follows: |
|---|
| 131 | % |
|---|
| 132 | % o x: the distance from the sampling point generally in the range of 0 to |
|---|
| 133 | % support. The GetResizeFilterWeight() ensures this a positive value. |
|---|
| 134 | % |
|---|
| 135 | % o resize_filter: current filter information. This allows function to |
|---|
| 136 | % access support, and possibly other pre-calculated information defining |
|---|
| 137 | % the functions. |
|---|
| 138 | % |
|---|
| 139 | */ |
|---|
| 140 | |
|---|
| 141 | static MagickRealType Blackman(const MagickRealType x, |
|---|
| 142 | const ResizeFilter *magick_unused(resize_filter)) |
|---|
| 143 | { |
|---|
| 144 | /* |
|---|
| 145 | Blackman: 2nd order cosine windowing function: |
|---|
| 146 | 0.42 + 0.5 cos(pi x) + 0.08 cos(2pi x) |
|---|
| 147 | |
|---|
| 148 | Refactored by Chantal Racette and Nicolas Robidoux to one trig call and |
|---|
| 149 | five flops. |
|---|
| 150 | */ |
|---|
| 151 | const MagickRealType cosine=cos((double) (MagickPI*x)); |
|---|
| 152 | return(0.34+cosine*(0.5+cosine*0.16)); |
|---|
| 153 | } |
|---|
| 154 | |
|---|
| 155 | static MagickRealType Bohman(const MagickRealType x, |
|---|
| 156 | const ResizeFilter *magick_unused(resize_filter)) |
|---|
| 157 | { |
|---|
| 158 | /* |
|---|
| 159 | Bohman: 2rd Order cosine windowing function: |
|---|
| 160 | (1-x) cos(pi x) + sin(pi x) / pi. |
|---|
| 161 | |
|---|
| 162 | Refactored by Nicolas Robidoux to one trig call, one sqrt call, and 7 flops, |
|---|
| 163 | taking advantage of the fact that the support of Bohman is 1.0 (so that we |
|---|
| 164 | know that sin(pi x) >= 0). |
|---|
| 165 | */ |
|---|
| 166 | const MagickRealType cosine=cos((double) (MagickPI*x)); |
|---|
| 167 | const MagickRealType sine=sqrt(1.0-cosine*cosine); |
|---|
| 168 | return((1.0-x)*cosine+(1.0/MagickPI)*sine); |
|---|
| 169 | } |
|---|
| 170 | |
|---|
| 171 | static MagickRealType Box(const MagickRealType magick_unused(x), |
|---|
| 172 | const ResizeFilter *magick_unused(resize_filter)) |
|---|
| 173 | { |
|---|
| 174 | /* |
|---|
| 175 | A Box filter is a equal weighting function (all weights equal). |
|---|
| 176 | DO NOT LIMIT results by support or resize point sampling will work |
|---|
| 177 | as it requests points beyond its normal 0.0 support size. |
|---|
| 178 | */ |
|---|
| 179 | return(1.0); |
|---|
| 180 | } |
|---|
| 181 | |
|---|
| 182 | static MagickRealType Cosine(const MagickRealType x, |
|---|
| 183 | const ResizeFilter *magick_unused(resize_filter)) |
|---|
| 184 | { |
|---|
| 185 | /* |
|---|
| 186 | Cosine window function: |
|---|
| 187 | cos((pi/2)*x). |
|---|
| 188 | */ |
|---|
| 189 | return((MagickRealType)cos((double) (MagickPI2*x))); |
|---|
| 190 | } |
|---|
| 191 | |
|---|
| 192 | static MagickRealType CubicBC(const MagickRealType x, |
|---|
| 193 | const ResizeFilter *resize_filter) |
|---|
| 194 | { |
|---|
| 195 | /* |
|---|
| 196 | Cubic Filters using B,C determined values: |
|---|
| 197 | Mitchell-Netravali B = 1/3 C = 1/3 "Balanced" cubic spline filter |
|---|
| 198 | Catmull-Rom B = 0 C = 1/2 Interpolatory and exact on linears |
|---|
| 199 | Cubic B-Spline B = 1 C = 0 Spline approximation of Gaussian |
|---|
| 200 | Hermite B = 0 C = 0 Spline with small support (= 1) |
|---|
| 201 | |
|---|
| 202 | See paper by Mitchell and Netravali, Reconstruction Filters in Computer |
|---|
| 203 | Graphics Computer Graphics, Volume 22, Number 4, August 1988 |
|---|
| 204 | http://www.cs.utexas.edu/users/fussell/courses/cs384g/lectures/mitchell/ |
|---|
| 205 | Mitchell.pdf. |
|---|
| 206 | |
|---|
| 207 | Coefficents are determined from B,C values: |
|---|
| 208 | P0 = ( 6 - 2*B )/6 = coeff[0] |
|---|
| 209 | P1 = 0 |
|---|
| 210 | P2 = (-18 +12*B + 6*C )/6 = coeff[1] |
|---|
| 211 | P3 = ( 12 - 9*B - 6*C )/6 = coeff[2] |
|---|
| 212 | Q0 = ( 8*B +24*C )/6 = coeff[3] |
|---|
| 213 | Q1 = ( -12*B -48*C )/6 = coeff[4] |
|---|
| 214 | Q2 = ( 6*B +30*C )/6 = coeff[5] |
|---|
| 215 | Q3 = ( - 1*B - 6*C )/6 = coeff[6] |
|---|
| 216 | |
|---|
| 217 | which are used to define the filter: |
|---|
| 218 | |
|---|
| 219 | P0 + P1*x + P2*x^2 + P3*x^3 0 <= x < 1 |
|---|
| 220 | Q0 + Q1*x + Q2*x^2 + Q3*x^3 1 <= x < 2 |
|---|
| 221 | |
|---|
| 222 | which ensures function is continuous in value and derivative (slope). |
|---|
| 223 | */ |
|---|
| 224 | if (x < 1.0) |
|---|
| 225 | return(resize_filter->coefficient[0]+x*(x* |
|---|
| 226 | (resize_filter->coefficient[1]+x*resize_filter->coefficient[2]))); |
|---|
| 227 | if (x < 2.0) |
|---|
| 228 | return(resize_filter->coefficient[3]+x*(resize_filter->coefficient[4]+x* |
|---|
| 229 | (resize_filter->coefficient[5]+x*resize_filter->coefficient[6]))); |
|---|
| 230 | return(0.0); |
|---|
| 231 | } |
|---|
| 232 | |
|---|
| 233 | static MagickRealType Gaussian(const MagickRealType x, |
|---|
| 234 | const ResizeFilter *resize_filter) |
|---|
| 235 | { |
|---|
| 236 | /* |
|---|
| 237 | Gaussian with a sigma = 1/2 (or as user specified) |
|---|
| 238 | |
|---|
| 239 | Gaussian Formula (1D) ... |
|---|
| 240 | exp( -(x^2)/((2.0*sigma^2) ) / (sqrt(2*PI)*sigma^2)) |
|---|
| 241 | |
|---|
| 242 | Gaussian Formula (2D) ... |
|---|
| 243 | exp( -(x^2+y^2)/(2.0*sigma^2) ) / (PI*sigma^2) ) |
|---|
| 244 | or for radius |
|---|
| 245 | exp( -(r^2)/(2.0*sigma^2) ) / (PI*sigma^2) ) |
|---|
| 246 | |
|---|
| 247 | Note that it is only a change from 1-d to radial form is in the |
|---|
| 248 | normalization multiplier which is not needed or used when Gaussian is used |
|---|
| 249 | as a filter. |
|---|
| 250 | |
|---|
| 251 | The constants are pre-calculated... |
|---|
| 252 | |
|---|
| 253 | coeff[0]=sigma; |
|---|
| 254 | coeff[1]=1.0/(2.0*sigma^2); |
|---|
| 255 | coeff[2]=1.0/(sqrt(2*PI)*sigma^2); |
|---|
| 256 | |
|---|
| 257 | exp( -coeff[1]*(x^2)) ) * coeff[2]; |
|---|
| 258 | |
|---|
| 259 | However the multiplier coeff[1] is need, the others are informative only. |
|---|
| 260 | |
|---|
| 261 | This separates the gaussian 'sigma' value from the 'blur/support' |
|---|
| 262 | settings allowing for its use in special 'small sigma' gaussians, |
|---|
| 263 | without the filter 'missing' pixels because the support becomes too |
|---|
| 264 | small. |
|---|
| 265 | */ |
|---|
| 266 | return(exp((double)(-resize_filter->coefficient[1]*x*x))); |
|---|
| 267 | } |
|---|
| 268 | |
|---|
| 269 | static MagickRealType Hanning(const MagickRealType x, |
|---|
| 270 | const ResizeFilter *magick_unused(resize_filter)) |
|---|
| 271 | { |
|---|
| 272 | /* |
|---|
| 273 | Cosine window function: |
|---|
| 274 | 0.5+0.5*cos(pi*x). |
|---|
| 275 | */ |
|---|
| 276 | const MagickRealType cosine=cos((double) (MagickPI*x)); |
|---|
| 277 | return(0.5+0.5*cosine); |
|---|
| 278 | } |
|---|
| 279 | |
|---|
| 280 | static MagickRealType Hamming(const MagickRealType x, |
|---|
| 281 | const ResizeFilter *magick_unused(resize_filter)) |
|---|
| 282 | { |
|---|
| 283 | /* |
|---|
| 284 | Offset cosine window function: |
|---|
| 285 | .54 + .46 cos(pi x). |
|---|
| 286 | */ |
|---|
| 287 | const MagickRealType cosine=cos((double) (MagickPI*x)); |
|---|
| 288 | return(0.54+0.46*cosine); |
|---|
| 289 | } |
|---|
| 290 | |
|---|
| 291 | static MagickRealType Jinc(const MagickRealType x, |
|---|
| 292 | const ResizeFilter *magick_unused(resize_filter)) |
|---|
| 293 | { |
|---|
| 294 | /* |
|---|
| 295 | See Pratt "Digital Image Processing" p.97 for Jinc/Bessel functions. |
|---|
| 296 | http://mathworld.wolfram.com/JincFunction.html and page 11 of |
|---|
| 297 | http://www.ph.ed.ac.uk/%7ewjh/teaching/mo/slides/lens/lens.pdf |
|---|
| 298 | |
|---|
| 299 | The original "zoom" program by Paul Heckbert called this "Bessel". But |
|---|
| 300 | really it is more accurately named "Jinc". |
|---|
| 301 | */ |
|---|
| 302 | if (x == 0.0) |
|---|
| 303 | return(0.5*MagickPI); |
|---|
| 304 | return(BesselOrderOne(MagickPI*x)/x); |
|---|
| 305 | } |
|---|
| 306 | |
|---|
| 307 | static MagickRealType Kaiser(const MagickRealType x, |
|---|
| 308 | const ResizeFilter *resize_filter) |
|---|
| 309 | { |
|---|
| 310 | /* |
|---|
| 311 | Kaiser Windowing Function (bessel windowing) |
|---|
| 312 | Alpha (coeff[0]) is a free value from 5 to 8 (defaults to 6.5). |
|---|
| 313 | A scaling factor (coeff[1]) is not actually needed as filter will |
|---|
| 314 | automatically be normalized. |
|---|
| 315 | */ |
|---|
| 316 | return(resize_filter->coefficient[1]* |
|---|
| 317 | I0(resize_filter->coefficient[0]*sqrt((double) (1.0-x*x)))); |
|---|
| 318 | } |
|---|
| 319 | |
|---|
| 320 | static MagickRealType Lagrange(const MagickRealType x, |
|---|
| 321 | const ResizeFilter *resize_filter) |
|---|
| 322 | { |
|---|
| 323 | MagickRealType |
|---|
| 324 | value; |
|---|
| 325 | |
|---|
| 326 | register ssize_t |
|---|
| 327 | i; |
|---|
| 328 | |
|---|
| 329 | ssize_t |
|---|
| 330 | n, |
|---|
| 331 | order; |
|---|
| 332 | |
|---|
| 333 | /* |
|---|
| 334 | Lagrange piecewise polynomial fit of sinc: N is the 'order' of the lagrange |
|---|
| 335 | function and depends on the overall support window size of the filter. That |
|---|
| 336 | is: for a support of 2, it gives a lagrange-4 (piecewise cubic function). |
|---|
| 337 | |
|---|
| 338 | "n" identifies the piece of the piecewise polynomial. |
|---|
| 339 | |
|---|
| 340 | See Survey: Interpolation Methods, IEEE Transactions on Medical Imaging, |
|---|
| 341 | Vol 18, No 11, November 1999, p1049-1075, -- Equation 27 on p1064. |
|---|
| 342 | */ |
|---|
| 343 | if (x > resize_filter->support) |
|---|
| 344 | return(0.0); |
|---|
| 345 | order=(ssize_t) (2.0*resize_filter->window_support); /* number of pieces */ |
|---|
| 346 | n=(ssize_t) (resize_filter->window_support+x); |
|---|
| 347 | value=1.0f; |
|---|
| 348 | for (i=0; i < order; i++) |
|---|
| 349 | if (i != n) |
|---|
| 350 | value*=(n-i-x)/(n-i); |
|---|
| 351 | return(value); |
|---|
| 352 | } |
|---|
| 353 | |
|---|
| 354 | static MagickRealType Quadratic(const MagickRealType x, |
|---|
| 355 | const ResizeFilter *magick_unused(resize_filter)) |
|---|
| 356 | { |
|---|
| 357 | /* |
|---|
| 358 | 2rd order (quadratic) B-Spline approximation of Gaussian. |
|---|
| 359 | */ |
|---|
| 360 | if (x < 0.5) |
|---|
| 361 | return(0.75-x*x); |
|---|
| 362 | if (x < 1.5) |
|---|
| 363 | return(0.5*(x-1.5)*(x-1.5)); |
|---|
| 364 | return(0.0); |
|---|
| 365 | } |
|---|
| 366 | |
|---|
| 367 | static MagickRealType Sinc(const MagickRealType x, |
|---|
| 368 | const ResizeFilter *magick_unused(resize_filter)) |
|---|
| 369 | { |
|---|
| 370 | /* |
|---|
| 371 | Scaled sinc(x) function using a trig call: |
|---|
| 372 | sinc(x) == sin(pi x)/(pi x). |
|---|
| 373 | */ |
|---|
| 374 | if (x != 0.0) |
|---|
| 375 | { |
|---|
| 376 | const MagickRealType alpha=(MagickRealType) (MagickPI*x); |
|---|
| 377 | return(sin((double) alpha)/alpha); |
|---|
| 378 | } |
|---|
| 379 | return((MagickRealType) 1.0); |
|---|
| 380 | } |
|---|
| 381 | |
|---|
| 382 | static MagickRealType SincFast(const MagickRealType x, |
|---|
| 383 | const ResizeFilter *magick_unused(resize_filter)) |
|---|
| 384 | { |
|---|
| 385 | /* |
|---|
| 386 | Approximations of the sinc function sin(pi x)/(pi x) over the interval |
|---|
| 387 | [-4,4] constructed by Nicolas Robidoux and Chantal Racette with funding |
|---|
| 388 | from the Natural Sciences and Engineering Research Council of Canada. |
|---|
| 389 | |
|---|
| 390 | Although the approximations are polynomials (for low order of |
|---|
| 391 | approximation) and quotients of polynomials (for higher order of |
|---|
| 392 | approximation) and consequently are similar in form to Taylor polynomials / |
|---|
| 393 | Pade approximants, the approximations are computed with a completely |
|---|
| 394 | different technique. |
|---|
| 395 | |
|---|
| 396 | Summary: These approximations are "the best" in terms of bang (accuracy) |
|---|
| 397 | for the buck (flops). More specifically: Among the polynomial quotients |
|---|
| 398 | that can be computed using a fixed number of flops (with a given "+ - * / |
|---|
| 399 | budget"), the chosen polynomial quotient is the one closest to the |
|---|
| 400 | approximated function with respect to maximum absolute relative error over |
|---|
| 401 | the given interval. |
|---|
| 402 | |
|---|
| 403 | The Remez algorithm, as implemented in the boost library's minimax package, |
|---|
| 404 | is the key to the construction: http://www.boost.org/doc/libs/1_36_0/libs/ |
|---|
| 405 | math/doc/sf_and_dist/html/math_toolkit/backgrounders/remez.html |
|---|
| 406 | |
|---|
| 407 | If outside of the interval of approximation, use the standard trig formula. |
|---|
| 408 | */ |
|---|
| 409 | if (x > 4.0) |
|---|
| 410 | { |
|---|
| 411 | const MagickRealType alpha=(MagickRealType) (MagickPI*x); |
|---|
| 412 | return(sin((double) alpha)/alpha); |
|---|
| 413 | } |
|---|
| 414 | { |
|---|
| 415 | /* |
|---|
| 416 | The approximations only depend on x^2 (sinc is an even function). |
|---|
| 417 | */ |
|---|
| 418 | const MagickRealType xx = x*x; |
|---|
| 419 | #if MAGICKCORE_QUANTUM_DEPTH <= 8 |
|---|
| 420 | /* |
|---|
| 421 | Maximum absolute relative error 6.3e-6 < 1/2^17. |
|---|
| 422 | */ |
|---|
| 423 | const MagickRealType c0 = 0.173610016489197553621906385078711564924e-2L; |
|---|
| 424 | const MagickRealType c1 = -0.384186115075660162081071290162149315834e-3L; |
|---|
| 425 | const MagickRealType c2 = 0.393684603287860108352720146121813443561e-4L; |
|---|
| 426 | const MagickRealType c3 = -0.248947210682259168029030370205389323899e-5L; |
|---|
| 427 | const MagickRealType c4 = 0.107791837839662283066379987646635416692e-6L; |
|---|
| 428 | const MagickRealType c5 = -0.324874073895735800961260474028013982211e-8L; |
|---|
| 429 | const MagickRealType c6 = 0.628155216606695311524920882748052490116e-10L; |
|---|
| 430 | const MagickRealType c7 = -0.586110644039348333520104379959307242711e-12L; |
|---|
| 431 | const MagickRealType p = |
|---|
| 432 | c0+xx*(c1+xx*(c2+xx*(c3+xx*(c4+xx*(c5+xx*(c6+xx*c7)))))); |
|---|
| 433 | return((xx-1.0)*(xx-4.0)*(xx-9.0)*(xx-16.0)*p); |
|---|
| 434 | #elif MAGICKCORE_QUANTUM_DEPTH <= 16 |
|---|
| 435 | /* |
|---|
| 436 | Max. abs. rel. error 2.2e-8 < 1/2^25. |
|---|
| 437 | */ |
|---|
| 438 | const MagickRealType c0 = 0.173611107357320220183368594093166520811e-2L; |
|---|
| 439 | const MagickRealType c1 = -0.384240921114946632192116762889211361285e-3L; |
|---|
| 440 | const MagickRealType c2 = 0.394201182359318128221229891724947048771e-4L; |
|---|
| 441 | const MagickRealType c3 = -0.250963301609117217660068889165550534856e-5L; |
|---|
| 442 | const MagickRealType c4 = 0.111902032818095784414237782071368805120e-6L; |
|---|
| 443 | const MagickRealType c5 = -0.372895101408779549368465614321137048875e-8L; |
|---|
| 444 | const MagickRealType c6 = 0.957694196677572570319816780188718518330e-10L; |
|---|
| 445 | const MagickRealType c7 = -0.187208577776590710853865174371617338991e-11L; |
|---|
| 446 | const MagickRealType c8 = 0.253524321426864752676094495396308636823e-13L; |
|---|
| 447 | const MagickRealType c9 = -0.177084805010701112639035485248501049364e-15L; |
|---|
| 448 | const MagickRealType p = |
|---|
| 449 | c0+xx*(c1+xx*(c2+xx*(c3+xx*(c4+xx*(c5+xx*(c6+xx*(c7+xx*(c8+xx*c9)))))))); |
|---|
| 450 | return((xx-1.0)*(xx-4.0)*(xx-9.0)*(xx-16.0)*p); |
|---|
| 451 | #else |
|---|
| 452 | /* |
|---|
| 453 | Max. abs. rel. error 1.2e-12 < 1/2^39. |
|---|
| 454 | */ |
|---|
| 455 | const MagickRealType c0 = 0.173611111110910715186413700076827593074e-2L; |
|---|
| 456 | const MagickRealType c1 = -0.289105544717893415815859968653611245425e-3L; |
|---|
| 457 | const MagickRealType c2 = 0.206952161241815727624413291940849294025e-4L; |
|---|
| 458 | const MagickRealType c3 = -0.834446180169727178193268528095341741698e-6L; |
|---|
| 459 | const MagickRealType c4 = 0.207010104171026718629622453275917944941e-7L; |
|---|
| 460 | const MagickRealType c5 = -0.319724784938507108101517564300855542655e-9L; |
|---|
| 461 | const MagickRealType c6 = 0.288101675249103266147006509214934493930e-11L; |
|---|
| 462 | const MagickRealType c7 = -0.118218971804934245819960233886876537953e-13L; |
|---|
| 463 | const MagickRealType p = |
|---|
| 464 | c0+xx*(c1+xx*(c2+xx*(c3+xx*(c4+xx*(c5+xx*(c6+xx*c7)))))); |
|---|
| 465 | const MagickRealType d0 = 1.0L; |
|---|
| 466 | const MagickRealType d1 = 0.547981619622284827495856984100563583948e-1L; |
|---|
| 467 | const MagickRealType d2 = 0.134226268835357312626304688047086921806e-2L; |
|---|
| 468 | const MagickRealType d3 = 0.178994697503371051002463656833597608689e-4L; |
|---|
| 469 | const MagickRealType d4 = 0.114633394140438168641246022557689759090e-6L; |
|---|
| 470 | const MagickRealType q = d0+xx*(d1+xx*(d2+xx*(d3+xx*d4))); |
|---|
| 471 | return((xx-1.0)*(xx-4.0)*(xx-9.0)*(xx-16.0)/q*p); |
|---|
| 472 | #endif |
|---|
| 473 | } |
|---|
| 474 | } |
|---|
| 475 | |
|---|
| 476 | static MagickRealType Triangle(const MagickRealType x, |
|---|
| 477 | const ResizeFilter *magick_unused(resize_filter)) |
|---|
| 478 | { |
|---|
| 479 | /* |
|---|
| 480 | 1st order (linear) B-Spline, bilinear interpolation, Tent 1D filter, or |
|---|
| 481 | a Bartlett 2D Cone filter. Also used as a Bartlett Windowing function |
|---|
| 482 | for Sinc(). |
|---|
| 483 | */ |
|---|
| 484 | if (x < 1.0) |
|---|
| 485 | return(1.0-x); |
|---|
| 486 | return(0.0); |
|---|
| 487 | } |
|---|
| 488 | |
|---|
| 489 | static MagickRealType Welsh(const MagickRealType x, |
|---|
| 490 | const ResizeFilter *magick_unused(resize_filter)) |
|---|
| 491 | { |
|---|
| 492 | /* |
|---|
| 493 | Welsh parabolic windowing filter. |
|---|
| 494 | */ |
|---|
| 495 | if (x < 1.0) |
|---|
| 496 | return(1.0-x*x); |
|---|
| 497 | return(0.0); |
|---|
| 498 | } |
|---|
| 499 | |
|---|
| 500 | /* |
|---|
| 501 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 502 | % % |
|---|
| 503 | % % |
|---|
| 504 | % % |
|---|
| 505 | + A c q u i r e R e s i z e F i l t e r % |
|---|
| 506 | % % |
|---|
| 507 | % % |
|---|
| 508 | % % |
|---|
| 509 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 510 | % |
|---|
| 511 | % AcquireResizeFilter() allocates the ResizeFilter structure. Choose from |
|---|
| 512 | % these filters: |
|---|
| 513 | % |
|---|
| 514 | % FIR (Finite impulse Response) Filters |
|---|
| 515 | % Box Triangle Quadratic |
|---|
| 516 | % Cubic Hermite Catrom |
|---|
| 517 | % Mitchell |
|---|
| 518 | % |
|---|
| 519 | % IIR (Infinite impulse Response) Filters |
|---|
| 520 | % Gaussian Sinc Jinc (Bessel) |
|---|
| 521 | % |
|---|
| 522 | % Windowed Sinc/Jinc Filters |
|---|
| 523 | % Blackman Hanning Hamming |
|---|
| 524 | % Kaiser Lanczos |
|---|
| 525 | % |
|---|
| 526 | % Special purpose Filters |
|---|
| 527 | % SincFast LanczosSharp Lanczos2 Lanczos2Sharp |
|---|
| 528 | % Robidoux RobidouxSharp |
|---|
| 529 | % |
|---|
| 530 | % The users "-filter" selection is used to lookup the default 'expert' |
|---|
| 531 | % settings for that filter from a internal table. However any provided |
|---|
| 532 | % 'expert' settings (see below) may override this selection. |
|---|
| 533 | % |
|---|
| 534 | % FIR filters are used as is, and are limited to that filters support window |
|---|
| 535 | % (unless over-ridden). 'Gaussian' while classed as an IIR filter, is also |
|---|
| 536 | % simply clipped by its support size (currently 1.5 or approximatally 3*sigma |
|---|
| 537 | % as recommended by many references) |
|---|
| 538 | % |
|---|
| 539 | % The special a 'cylindrical' filter flag will promote the default 4-lobed |
|---|
| 540 | % Windowed Sinc filter to a 3-lobed Windowed Jinc equivalent, which is better |
|---|
| 541 | % suited to this style of image resampling. This typically happens when using |
|---|
| 542 | % such a filter for images distortions. |
|---|
| 543 | % |
|---|
| 544 | % SPECIFIC FILTERS: |
|---|
| 545 | % |
|---|
| 546 | % Directly requesting 'Sinc', 'Jinc' function as a filter will force the use |
|---|
| 547 | % of function without any windowing, or promotion for cylindrical usage. This |
|---|
| 548 | % is not recommended, except by image processing experts, especially as part |
|---|
| 549 | % of expert option filter function selection. |
|---|
| 550 | % |
|---|
| 551 | % Two forms of the 'Sinc' function are available: Sinc and SincFast. Sinc is |
|---|
| 552 | % computed using the traditional sin(pi*x)/(pi*x); it is selected if the user |
|---|
| 553 | % specifically specifies the use of a Sinc filter. SincFast uses highly |
|---|
| 554 | % accurate (and fast) polynomial (low Q) and rational (high Q) approximations, |
|---|
| 555 | % and will be used by default in most cases. |
|---|
| 556 | % |
|---|
| 557 | % The Lanczos filter is a special 3-lobed Sinc-windowed Sinc filter (promoted |
|---|
| 558 | % to Jinc-windowed Jinc for cylindrical (Elliptical Weighted Average) use). |
|---|
| 559 | % The Sinc version is the most popular windowed filter. |
|---|
| 560 | % |
|---|
| 561 | % LanczosSharp is a slightly sharpened (blur=0.9812505644269356 < 1) form of |
|---|
| 562 | % the Lanczos filter, specifically designed for EWA distortion (as a |
|---|
| 563 | % Jinc-Jinc); it can also be used as a slightly sharper orthogonal Lanczos |
|---|
| 564 | % (Sinc-Sinc) filter. The chosen blur value comes as close as possible to |
|---|
| 565 | % satisfying the following condition without changing the character of the |
|---|
| 566 | % corresponding EWA filter: |
|---|
| 567 | % |
|---|
| 568 | % 'No-Op' Vertical and Horizontal Line Preservation Condition: Images with |
|---|
| 569 | % only vertical or horizontal features are preserved when performing 'no-op" |
|---|
| 570 | % with EWA distortion. |
|---|
| 571 | % |
|---|
| 572 | % The Lanczos2 and Lanczos2Sharp filters are 2-lobe versions of the Lanczos |
|---|
| 573 | % filters. The 'sharp' version uses a blur factor of 0.9549963639785485, |
|---|
| 574 | % again chosen because the resulting EWA filter comes as close as possible to |
|---|
| 575 | % satisfying the above condition. |
|---|
| 576 | % |
|---|
| 577 | % Robidoux is another filter tuned for EWA. It is the Keys cubic filter |
|---|
| 578 | % defined by B=(228 - 108 sqrt(2))/199. Robidoux satisfies the "'No-Op' |
|---|
| 579 | % Vertical and Horizontal Line Preservation Condition" exactly, and it |
|---|
| 580 | % moderately blurs high frequency 'pixel-hash' patterns under no-op. It turns |
|---|
| 581 | % out to be close to both Mitchell and Lanczos2Sharp. For example, its first |
|---|
| 582 | % crossing is at (36 sqrt(2) + 123)/(72 sqrt(2) + 47), almost the same as the |
|---|
| 583 | % first crossing of Mitchell and Lanczos2Sharp. |
|---|
| 584 | % |
|---|
| 585 | % RodidouxSharp is a slightly sharper version of Rodidoux, some believe it |
|---|
| 586 | % is too sharp. It is designed to minimize the maximum possible change in |
|---|
| 587 | % a pixel value which is at one of the extremes (e.g., 0 or 255) under no-op |
|---|
| 588 | % conditions. Amazingly Mitchell falls roughly between Rodidoux and |
|---|
| 589 | % RodidouxSharp, though this seems to have been pure coincidence. |
|---|
| 590 | % |
|---|
| 591 | % 'EXPERT' OPTIONS: |
|---|
| 592 | % |
|---|
| 593 | % These artifact "defines" are not recommended for production use without |
|---|
| 594 | % expert knowledge of resampling, filtering, and the effects they have on the |
|---|
| 595 | % resulting resampled (resize ro distorted) image. |
|---|
| 596 | % |
|---|
| 597 | % They can be used to override any and all filter default, and it is |
|---|
| 598 | % recommended you make good use of "filter:verbose" to make sure that the |
|---|
| 599 | % overall effect of your selection (before and after) is as expected. |
|---|
| 600 | % |
|---|
| 601 | % "filter:verbose" controls whether to output the exact results of the |
|---|
| 602 | % filter selections made, as well as plotting data for graphing the |
|---|
| 603 | % resulting filter over the filters support range. |
|---|
| 604 | % |
|---|
| 605 | % "filter:filter" select the main function associated with this filter |
|---|
| 606 | % name, as the weighting function of the filter. This can be used to |
|---|
| 607 | % set a windowing function as a weighting function, for special |
|---|
| 608 | % purposes, such as graphing. |
|---|
| 609 | % |
|---|
| 610 | % If a "filter:window" operation has not been provided, a 'Box' |
|---|
| 611 | % windowing function will be set to denote that no windowing function is |
|---|
| 612 | % being used. |
|---|
| 613 | % |
|---|
| 614 | % "filter:window" Select this windowing function for the filter. While any |
|---|
| 615 | % filter could be used as a windowing function, using the 'first lobe' of |
|---|
| 616 | % that filter over the whole support window, using a non-windowing |
|---|
| 617 | % function is not advisible. If no weighting filter function is specifed |
|---|
| 618 | % a 'SincFast' filter is used. |
|---|
| 619 | % |
|---|
| 620 | % "filter:lobes" Number of lobes to use for the Sinc/Jinc filter. This a |
|---|
| 621 | % simpler method of setting filter support size that will correctly |
|---|
| 622 | % handle the Sinc/Jinc switch for an operators filtering requirements. |
|---|
| 623 | % Only integers should be given. |
|---|
| 624 | % |
|---|
| 625 | % "filter:support" Set the support size for filtering to the size given. |
|---|
| 626 | % This not recommended for Sinc/Jinc windowed filters (lobes should be |
|---|
| 627 | % used instead). This will override any 'filter:lobes' option. |
|---|
| 628 | % |
|---|
| 629 | % "filter:win-support" Scale windowing function to this size instead. This |
|---|
| 630 | % causes the windowing (or self-windowing Lagrange filter) to act is if |
|---|
| 631 | % the support window it much much larger than what is actually supplied |
|---|
| 632 | % to the calling operator. The filter however is still clipped to the |
|---|
| 633 | % real support size given, by the support range suppiled to the caller. |
|---|
| 634 | % If unset this will equal the normal filter support size. |
|---|
| 635 | % |
|---|
| 636 | % "filter:blur" Scale the filter and support window by this amount. A value |
|---|
| 637 | % > 1 will generally result in a more burred image with more ringing |
|---|
| 638 | % effects, while a value <1 will sharpen the resulting image with more |
|---|
| 639 | % aliasing effects. |
|---|
| 640 | % |
|---|
| 641 | % "filter:sigma" The sigma value to use for the Gaussian filter only. |
|---|
| 642 | % Defaults to '1/2'. Using a different sigma effectively provides a |
|---|
| 643 | % method of using the filter as a 'blur' convolution. Particularly when |
|---|
| 644 | % using it for Distort. |
|---|
| 645 | % |
|---|
| 646 | % "filter:b" |
|---|
| 647 | % "filter:c" Override the preset B,C values for a Cubic type of filter. |
|---|
| 648 | % If only one of these are given it is assumes to be a 'Keys' type of |
|---|
| 649 | % filter such that B+2C=1, where Keys 'alpha' value = C. |
|---|
| 650 | % |
|---|
| 651 | % Examples: |
|---|
| 652 | % |
|---|
| 653 | % Set a true un-windowed Sinc filter with 10 lobes (very slow): |
|---|
| 654 | % -define filter:filter=Sinc |
|---|
| 655 | % -define filter:lobes=8 |
|---|
| 656 | % |
|---|
| 657 | % Set an 8 lobe Lanczos (Sinc or Jinc) filter: |
|---|
| 658 | % -filter Lanczos |
|---|
| 659 | % -define filter:lobes=8 |
|---|
| 660 | % |
|---|
| 661 | % The format of the AcquireResizeFilter method is: |
|---|
| 662 | % |
|---|
| 663 | % ResizeFilter *AcquireResizeFilter(const Image *image, |
|---|
| 664 | % const FilterTypes filter_type,const MagickBooleanType cylindrical, |
|---|
| 665 | % ExceptionInfo *exception) |
|---|
| 666 | % |
|---|
| 667 | % A description of each parameter follows: |
|---|
| 668 | % |
|---|
| 669 | % o image: the image. |
|---|
| 670 | % |
|---|
| 671 | % o filter: the filter type, defining a preset filter, window and support. |
|---|
| 672 | % The artifact settings listed above will override those selections. |
|---|
| 673 | % |
|---|
| 674 | % o blur: blur the filter by this amount, use 1.0 if unknown. Image |
|---|
| 675 | % artifact "filter:blur" will override this API call usage, including any |
|---|
| 676 | % internal change (such as for cylindrical usage). |
|---|
| 677 | % |
|---|
| 678 | % o radial: use a 1D orthogonal filter (Sinc) or 2D cylindrical (radial) |
|---|
| 679 | % filter (Jinc). |
|---|
| 680 | % |
|---|
| 681 | % o exception: return any errors or warnings in this structure. |
|---|
| 682 | % |
|---|
| 683 | */ |
|---|
| 684 | MagickPrivate ResizeFilter *AcquireResizeFilter(const Image *image, |
|---|
| 685 | const FilterTypes filter,const MagickBooleanType cylindrical, |
|---|
| 686 | ExceptionInfo *exception) |
|---|
| 687 | { |
|---|
| 688 | const char |
|---|
| 689 | *artifact; |
|---|
| 690 | |
|---|
| 691 | FilterTypes |
|---|
| 692 | filter_type, |
|---|
| 693 | window_type; |
|---|
| 694 | |
|---|
| 695 | MagickRealType |
|---|
| 696 | B, |
|---|
| 697 | C, |
|---|
| 698 | value; |
|---|
| 699 | |
|---|
| 700 | register ResizeFilter |
|---|
| 701 | *resize_filter; |
|---|
| 702 | |
|---|
| 703 | /* |
|---|
| 704 | Table Mapping given Filter, into Weighting and Windowing functions. |
|---|
| 705 | A 'Box' windowing function means its a simble non-windowed filter. |
|---|
| 706 | An 'SincFast' filter function could be upgraded to a 'Jinc' filter if a |
|---|
| 707 | "cylindrical" is requested, unless a 'Sinc' or 'SincFast' filter was |
|---|
| 708 | specifically requested by the user. |
|---|
| 709 | |
|---|
| 710 | WARNING: The order of this table must match the order of the FilterTypes |
|---|
| 711 | enumeration specified in "resample.h", or the filter names will not match |
|---|
| 712 | the filter being setup. |
|---|
| 713 | |
|---|
| 714 | You can check filter setups with the "filter:verbose" expert setting. |
|---|
| 715 | */ |
|---|
| 716 | static struct |
|---|
| 717 | { |
|---|
| 718 | FilterTypes |
|---|
| 719 | filter, |
|---|
| 720 | window; |
|---|
| 721 | } const mapping[SentinelFilter] = |
|---|
| 722 | { |
|---|
| 723 | { UndefinedFilter, BoxFilter }, /* Undefined (default to Box) */ |
|---|
| 724 | { PointFilter, BoxFilter }, /* SPECIAL: Nearest neighbour */ |
|---|
| 725 | { BoxFilter, BoxFilter }, /* Box averaging filter */ |
|---|
| 726 | { TriangleFilter, BoxFilter }, /* Linear interpolation filter */ |
|---|
| 727 | { HermiteFilter, BoxFilter }, /* Hermite interpolation filter */ |
|---|
| 728 | { SincFastFilter, HanningFilter }, /* Hanning -- cosine-sinc */ |
|---|
| 729 | { SincFastFilter, HammingFilter }, /* Hamming -- '' variation */ |
|---|
| 730 | { SincFastFilter, BlackmanFilter }, /* Blackman -- 2*cosine-sinc */ |
|---|
| 731 | { GaussianFilter, BoxFilter }, /* Gaussian blur filter */ |
|---|
| 732 | { QuadraticFilter, BoxFilter }, /* Quadratic Gaussian approx */ |
|---|
| 733 | { CubicFilter, BoxFilter }, /* Cubic B-Spline */ |
|---|
| 734 | { CatromFilter, BoxFilter }, /* Cubic-Keys interpolator */ |
|---|
| 735 | { MitchellFilter, BoxFilter }, /* 'Ideal' Cubic-Keys filter */ |
|---|
| 736 | { JincFilter, BoxFilter }, /* Raw 3-lobed Jinc function */ |
|---|
| 737 | { SincFilter, BoxFilter }, /* Raw 4-lobed Sinc function */ |
|---|
| 738 | { SincFastFilter, BoxFilter }, /* Raw fast sinc ("Pade"-type) */ |
|---|
| 739 | { SincFastFilter, KaiserFilter }, /* Kaiser -- square root-sinc */ |
|---|
| 740 | { SincFastFilter, WelshFilter }, /* Welsh -- parabolic-sinc */ |
|---|
| 741 | { SincFastFilter, CubicFilter }, /* Parzen -- cubic-sinc */ |
|---|
| 742 | { SincFastFilter, BohmanFilter }, /* Bohman -- 2*cosine-sinc */ |
|---|
| 743 | { SincFastFilter, TriangleFilter }, /* Bartlett -- triangle-sinc */ |
|---|
| 744 | { LagrangeFilter, BoxFilter }, /* Lagrange self-windowing */ |
|---|
| 745 | { LanczosFilter, LanczosFilter }, /* Lanczos Sinc-Sinc filters */ |
|---|
| 746 | { LanczosSharpFilter, LanczosSharpFilter }, /* | these require */ |
|---|
| 747 | { Lanczos2Filter, Lanczos2Filter }, /* | special handling */ |
|---|
| 748 | { Lanczos2SharpFilter, Lanczos2SharpFilter }, |
|---|
| 749 | { RobidouxFilter, BoxFilter }, /* Cubic Keys tuned for EWA */ |
|---|
| 750 | { RobidouxSharpFilter, BoxFilter }, /* Sharper Cubic Keys for EWA */ |
|---|
| 751 | { SincFastFilter, CosineFilter }, /* low level cosine window */ |
|---|
| 752 | }; |
|---|
| 753 | /* |
|---|
| 754 | Table mapping the filter/window from the above table to an actual function. |
|---|
| 755 | The default support size for that filter as a weighting function, the range |
|---|
| 756 | to scale with to use that function as a sinc windowing function, (typ 1.0). |
|---|
| 757 | |
|---|
| 758 | Note that the filter_type -> function is 1 to 1 except for Sinc(), |
|---|
| 759 | SincFast(), and CubicBC() functions, which may have multiple filter to |
|---|
| 760 | function associations. |
|---|
| 761 | |
|---|
| 762 | See "filter:verbose" handling below for the function -> filter mapping. |
|---|
| 763 | */ |
|---|
| 764 | static struct |
|---|
| 765 | { |
|---|
| 766 | MagickRealType |
|---|
| 767 | (*function)(const MagickRealType,const ResizeFilter*), |
|---|
| 768 | support, /* Default lobes/support size of the weighting filter. */ |
|---|
| 769 | scale, /* Support when function used as a windowing function |
|---|
| 770 | Typically equal to the location of the first zero crossing. */ |
|---|
| 771 | B,C; /* BC-spline coefficients, ignored if not a CubicBC filter. */ |
|---|
| 772 | } const filters[SentinelFilter] = |
|---|
| 773 | { |
|---|
| 774 | /* .--- support window |
|---|
| 775 | | .--- first crossing (if used as a Windowing function) |
|---|
| 776 | | | .--- B value for Cubic Function |
|---|
| 777 | | | | .---- C value for Cubic Function |
|---|
| 778 | | | | | */ |
|---|
| 779 | { Box, 0.5, 0.5, 0.0, 0.0 }, /* Undefined (default to Box) */ |
|---|
| 780 | { Box, 0.0, 0.5, 0.0, 0.0 }, /* Point (special handling) */ |
|---|
| 781 | { Box, 0.5, 0.5, 0.0, 0.0 }, /* Box */ |
|---|
| 782 | { Triangle, 1.0, 1.0, 0.0, 0.0 }, /* Triangle */ |
|---|
| 783 | { CubicBC, 1.0, 1.0, 0.0, 0.0 }, /* Hermite (cubic B=C=0) */ |
|---|
| 784 | { Hanning, 1.0, 1.0, 0.0, 0.0 }, /* Hanning, cosine window */ |
|---|
| 785 | { Hamming, 1.0, 1.0, 0.0, 0.0 }, /* Hamming, '' variation */ |
|---|
| 786 | { Blackman, 1.0, 1.0, 0.0, 0.0 }, /* Blackman, 2*cosine window */ |
|---|
| 787 | { Gaussian, 2.0, 1.5, 0.0, 0.0 }, /* Gaussian */ |
|---|
| 788 | { Quadratic, 1.5, 1.5, 0.0, 0.0 }, /* Quadratic gaussian */ |
|---|
| 789 | { CubicBC, 2.0, 2.0, 1.0, 0.0 }, /* Cubic B-Spline (B=1,C=0) */ |
|---|
| 790 | { CubicBC, 2.0, 1.0, 0.0, 0.5 }, /* Catmull-Rom (B=0,C=1/2) */ |
|---|
| 791 | { CubicBC, 2.0, 8.0/7.0, 1./3., 1./3. }, /* Mitchell (B=C=1/3) */ |
|---|
| 792 | { Jinc, 3.0, 1.2196698912665045, 0.0, 0.0 }, /* Raw 3-lobed Jinc */ |
|---|
| 793 | { Sinc, 4.0, 1.0, 0.0, 0.0 }, /* Raw 4-lobed Sinc */ |
|---|
| 794 | { SincFast, 4.0, 1.0, 0.0, 0.0 }, /* Raw fast sinc ("Pade"-type) */ |
|---|
| 795 | { Kaiser, 1.0, 1.0, 0.0, 0.0 }, /* Kaiser (square root window) */ |
|---|
| 796 | { Welsh, 1.0, 1.0, 0.0, 0.0 }, /* Welsh (parabolic window) */ |
|---|
| 797 | { CubicBC, 2.0, 2.0, 1.0, 0.0 }, /* Parzen (B-Spline window) */ |
|---|
| 798 | { Bohman, 1.0, 1.0, 0.0, 0.0 }, /* Bohman, 2*Cosine window */ |
|---|
| 799 | { Triangle, 1.0, 1.0, 0.0, 0.0 }, /* Bartlett (triangle window) */ |
|---|
| 800 | { Lagrange, 2.0, 1.0, 0.0, 0.0 }, /* Lagrange sinc approximation */ |
|---|
| 801 | { SincFast, 3.0, 1.0, 0.0, 0.0 }, /* Lanczos, 3-lobed Sinc-Sinc */ |
|---|
| 802 | { SincFast, 3.0, 1.0, 0.0, 0.0 }, /* lanczos, Sharpened */ |
|---|
| 803 | { SincFast, 2.0, 1.0, 0.0, 0.0 }, /* Lanczos, 2-lobed */ |
|---|
| 804 | { SincFast, 2.0, 1.0, 0.0, 0.0 }, /* Lanczos2, sharpened */ |
|---|
| 805 | /* Robidoux: Keys cubic close to Lanczos2D sharpened */ |
|---|
| 806 | { CubicBC, 2.0, 1.1685777620836932, |
|---|
| 807 | 0.37821575509399867, 0.31089212245300067 }, |
|---|
| 808 | /* RobidouxSharp: Sharper version of Robidoux */ |
|---|
| 809 | { CubicBC, 2.0, 1.105822933719019, |
|---|
| 810 | 0.2620145123990142, 0.3689927438004929 }, |
|---|
| 811 | { Cosine, 1.0, 1.0, 0.0, 0.0 } /* Low level cosine window */ |
|---|
| 812 | }; |
|---|
| 813 | /* |
|---|
| 814 | The known zero crossings of the Jinc() or more accurately the Jinc(x*PI) |
|---|
| 815 | function being used as a filter. It is used by the "filter:lobes" expert |
|---|
| 816 | setting and for 'lobes' for Jinc functions in the previous table. This way |
|---|
| 817 | users do not have to deal with the highly irrational lobe sizes of the Jinc |
|---|
| 818 | filter. |
|---|
| 819 | |
|---|
| 820 | Values taken from |
|---|
| 821 | http://cose.math.bas.bg/webMathematica/webComputing/BesselZeros.jsp |
|---|
| 822 | using Jv-function with v=1, then dividing by PI. |
|---|
| 823 | */ |
|---|
| 824 | static MagickRealType |
|---|
| 825 | jinc_zeros[16] = |
|---|
| 826 | { |
|---|
| 827 | 1.2196698912665045, |
|---|
| 828 | 2.2331305943815286, |
|---|
| 829 | 3.2383154841662362, |
|---|
| 830 | 4.2410628637960699, |
|---|
| 831 | 5.2427643768701817, |
|---|
| 832 | 6.2439216898644877, |
|---|
| 833 | 7.2447598687199570, |
|---|
| 834 | 8.2453949139520427, |
|---|
| 835 | 9.2458926849494673, |
|---|
| 836 | 10.246293348754916, |
|---|
| 837 | 11.246622794877883, |
|---|
| 838 | 12.246898461138105, |
|---|
| 839 | 13.247132522181061, |
|---|
| 840 | 14.247333735806849, |
|---|
| 841 | 15.247508563037300, |
|---|
| 842 | 16.247661874700962 |
|---|
| 843 | }; |
|---|
| 844 | |
|---|
| 845 | /* |
|---|
| 846 | Allocate resize filter. |
|---|
| 847 | */ |
|---|
| 848 | assert(image != (const Image *) NULL); |
|---|
| 849 | assert(image->signature == MagickSignature); |
|---|
| 850 | if( IfMagickTrue(image->debug) ) |
|---|
| 851 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
|---|
| 852 | assert(UndefinedFilter < filter && filter < SentinelFilter); |
|---|
| 853 | assert(exception != (ExceptionInfo *) NULL); |
|---|
| 854 | assert(exception->signature == MagickSignature); |
|---|
| 855 | resize_filter=(ResizeFilter *) AcquireMagickMemory(sizeof(*resize_filter)); |
|---|
| 856 | if (resize_filter == (ResizeFilter *) NULL) |
|---|
| 857 | ThrowFatalException(ResourceLimitFatalError,"MemoryAllocationFailed"); |
|---|
| 858 | (void) ResetMagickMemory(resize_filter,0,sizeof(*resize_filter)); |
|---|
| 859 | /* |
|---|
| 860 | Defaults for the requested filter. |
|---|
| 861 | */ |
|---|
| 862 | filter_type=mapping[filter].filter; |
|---|
| 863 | window_type=mapping[filter].window; |
|---|
| 864 | resize_filter->blur=1.0; |
|---|
| 865 | /* Promote 1D Windowed Sinc Filters to a 2D Windowed Jinc filters */ |
|---|
| 866 | if( IfMagickTrue(cylindrical) && (filter_type == SincFastFilter) && |
|---|
| 867 | (filter != SincFastFilter)) |
|---|
| 868 | filter_type=JincFilter; /* 1D Windowed Sinc => 2D Windowed Jinc filters */ |
|---|
| 869 | |
|---|
| 870 | /* Expert filter setting override */ |
|---|
| 871 | artifact=GetImageArtifact(image,"filter:filter"); |
|---|
| 872 | if (artifact != (const char *) NULL) |
|---|
| 873 | { |
|---|
| 874 | ssize_t |
|---|
| 875 | option; |
|---|
| 876 | |
|---|
| 877 | option=ParseCommandOption(MagickFilterOptions,MagickFalse,artifact); |
|---|
| 878 | if ((UndefinedFilter < option) && (option < SentinelFilter)) |
|---|
| 879 | { /* Raw filter request - no window function. */ |
|---|
| 880 | filter_type=(FilterTypes) option; |
|---|
| 881 | window_type=BoxFilter; |
|---|
| 882 | } |
|---|
| 883 | /* Filter override with a specific window function. */ |
|---|
| 884 | artifact=GetImageArtifact(image,"filter:window"); |
|---|
| 885 | if (artifact != (const char *) NULL) |
|---|
| 886 | { |
|---|
| 887 | option=ParseCommandOption(MagickFilterOptions,MagickFalse,artifact); |
|---|
| 888 | if ((UndefinedFilter < option) && (option < SentinelFilter)) |
|---|
| 889 | window_type=(FilterTypes) option; |
|---|
| 890 | } |
|---|
| 891 | } |
|---|
| 892 | else |
|---|
| 893 | { |
|---|
| 894 | /* Window specified, but no filter function? Assume Sinc/Jinc. */ |
|---|
| 895 | artifact=GetImageArtifact(image,"filter:window"); |
|---|
| 896 | if (artifact != (const char *) NULL) |
|---|
| 897 | { |
|---|
| 898 | ssize_t |
|---|
| 899 | option; |
|---|
| 900 | |
|---|
| 901 | option=ParseCommandOption(MagickFilterOptions,MagickFalse,artifact); |
|---|
| 902 | if ((UndefinedFilter < option) && (option < SentinelFilter)) |
|---|
| 903 | { |
|---|
| 904 | filter_type= IfMagickTrue(cylindrical) ? JincFilter |
|---|
| 905 | : SincFastFilter; |
|---|
| 906 | window_type=(FilterTypes) option; |
|---|
| 907 | } |
|---|
| 908 | } |
|---|
| 909 | } |
|---|
| 910 | |
|---|
| 911 | /* Assign the real functions to use for the filters selected. */ |
|---|
| 912 | resize_filter->filter=filters[filter_type].function; |
|---|
| 913 | resize_filter->support=filters[filter_type].support; |
|---|
| 914 | resize_filter->window=filters[window_type].function; |
|---|
| 915 | resize_filter->scale=filters[window_type].scale; |
|---|
| 916 | resize_filter->signature=MagickSignature; |
|---|
| 917 | |
|---|
| 918 | /* Filter Modifications for orthogonal/cylindrical usage */ |
|---|
| 919 | if (cylindrical != MagickFalse) |
|---|
| 920 | switch (filter_type) |
|---|
| 921 | { |
|---|
| 922 | case BoxFilter: |
|---|
| 923 | /* Support for Cylindrical Box should be sqrt(2)/2 */ |
|---|
| 924 | resize_filter->support=(MagickRealType) MagickSQ1_2; |
|---|
| 925 | break; |
|---|
| 926 | case LanczosFilter: |
|---|
| 927 | case LanczosSharpFilter: |
|---|
| 928 | case Lanczos2Filter: |
|---|
| 929 | case Lanczos2SharpFilter: |
|---|
| 930 | resize_filter->filter=filters[JincFilter].function; |
|---|
| 931 | resize_filter->window=filters[JincFilter].function; |
|---|
| 932 | resize_filter->scale=filters[JincFilter].scale; |
|---|
| 933 | /* number of lobes (support window size) remain unchanged */ |
|---|
| 934 | break; |
|---|
| 935 | default: |
|---|
| 936 | break; |
|---|
| 937 | } |
|---|
| 938 | /* Global Sharpening (regardless of orthoginal/cylindrical) */ |
|---|
| 939 | switch (filter_type) |
|---|
| 940 | { |
|---|
| 941 | case LanczosSharpFilter: |
|---|
| 942 | resize_filter->blur *= 0.9812505644269356; |
|---|
| 943 | break; |
|---|
| 944 | case Lanczos2SharpFilter: |
|---|
| 945 | resize_filter->blur *= 0.9549963639785485; |
|---|
| 946 | break; |
|---|
| 947 | default: |
|---|
| 948 | break; |
|---|
| 949 | } |
|---|
| 950 | |
|---|
| 951 | /* |
|---|
| 952 | Expert Option Modifications. |
|---|
| 953 | */ |
|---|
| 954 | |
|---|
| 955 | /* User Gaussian Sigma Override - no support change */ |
|---|
| 956 | if (resize_filter->filter == Gaussian) { |
|---|
| 957 | value=0.5; /* guassian sigma default, half pixel */ |
|---|
| 958 | artifact=GetImageArtifact(image,"filter:sigma"); |
|---|
| 959 | if (artifact != (const char *) NULL) |
|---|
| 960 | value=StringToDouble(artifact,(char **) NULL); |
|---|
| 961 | /* Define coefficents for Gaussian */ |
|---|
| 962 | resize_filter->coefficient[0]=value; /* note sigma too */ |
|---|
| 963 | resize_filter->coefficient[1]=1.0/(2.0*value*value); /* sigma scaling */ |
|---|
| 964 | resize_filter->coefficient[2]=(MagickRealType) |
|---|
| 965 | (1.0/(Magick2PI*value*value)); |
|---|
| 966 | /* normalization - not actually needed or used! */ |
|---|
| 967 | if ( value > 0.5 ) |
|---|
| 968 | resize_filter->support *= value/0.5; /* increase support */ |
|---|
| 969 | } |
|---|
| 970 | |
|---|
| 971 | /* User Kaiser Alpha Override - no support change */ |
|---|
| 972 | if (resize_filter->filter == Kaiser) { |
|---|
| 973 | value=6.5; /* default alpha value for Kaiser bessel windowing function */ |
|---|
| 974 | artifact=GetImageArtifact(image,"filter:alpha"); |
|---|
| 975 | if (artifact != (const char *) NULL) |
|---|
| 976 | value=StringToDouble(artifact,(char **) NULL); |
|---|
| 977 | /* Define coefficents for Kaiser Windowing Function */ |
|---|
| 978 | resize_filter->coefficient[0]=value; /* alpha */ |
|---|
| 979 | resize_filter->coefficient[1]=1.0/I0(value); /* normalization */ |
|---|
| 980 | } |
|---|
| 981 | |
|---|
| 982 | /* Blur Override */ |
|---|
| 983 | artifact=GetImageArtifact(image,"filter:blur"); |
|---|
| 984 | if (artifact != (const char *) NULL) |
|---|
| 985 | resize_filter->blur*=StringToDouble(artifact,(char **) NULL); |
|---|
| 986 | if (resize_filter->blur < MagickEpsilon) |
|---|
| 987 | resize_filter->blur=(MagickRealType) MagickEpsilon; |
|---|
| 988 | |
|---|
| 989 | /* Support Overrides */ |
|---|
| 990 | artifact=GetImageArtifact(image,"filter:lobes"); |
|---|
| 991 | if (artifact != (const char *) NULL) |
|---|
| 992 | { |
|---|
| 993 | ssize_t |
|---|
| 994 | lobes; |
|---|
| 995 | |
|---|
| 996 | lobes=(ssize_t) StringToLong(artifact); |
|---|
| 997 | if (lobes < 1) |
|---|
| 998 | lobes=1; |
|---|
| 999 | resize_filter->support=(MagickRealType) lobes; |
|---|
| 1000 | } |
|---|
| 1001 | /* Convert a Jinc function lobes value to a real support value */ |
|---|
| 1002 | if (resize_filter->filter == Jinc) |
|---|
| 1003 | { |
|---|
| 1004 | if (resize_filter->support > 16) |
|---|
| 1005 | resize_filter->support=jinc_zeros[15]; /* largest entry in table */ |
|---|
| 1006 | else |
|---|
| 1007 | resize_filter->support=jinc_zeros[((long)resize_filter->support)-1]; |
|---|
| 1008 | } |
|---|
| 1009 | /* expert override of the support setting */ |
|---|
| 1010 | artifact=GetImageArtifact(image,"filter:support"); |
|---|
| 1011 | if (artifact != (const char *) NULL) |
|---|
| 1012 | resize_filter->support=fabs(StringToDouble(artifact,(char **) NULL)); |
|---|
| 1013 | /* |
|---|
| 1014 | Scale windowing function separately to the support 'clipping' |
|---|
| 1015 | window that calling operator is planning to actually use. (Expert |
|---|
| 1016 | override) |
|---|
| 1017 | */ |
|---|
| 1018 | resize_filter->window_support=resize_filter->support; /* default */ |
|---|
| 1019 | artifact=GetImageArtifact(image,"filter:win-support"); |
|---|
| 1020 | if (artifact != (const char *) NULL) |
|---|
| 1021 | resize_filter->window_support=fabs(StringToDouble(artifact,(char **) NULL)); |
|---|
| 1022 | /* |
|---|
| 1023 | Adjust window function scaling to match windowing support for |
|---|
| 1024 | weighting function. This avoids a division on every filter call. |
|---|
| 1025 | */ |
|---|
| 1026 | resize_filter->scale/=resize_filter->window_support; |
|---|
| 1027 | |
|---|
| 1028 | /* |
|---|
| 1029 | * Set Cubic Spline B,C values, calculate Cubic coefficients. |
|---|
| 1030 | */ |
|---|
| 1031 | B=0.0; |
|---|
| 1032 | C=0.0; |
|---|
| 1033 | if ((filters[filter_type].function == CubicBC) || |
|---|
| 1034 | (filters[window_type].function == CubicBC)) |
|---|
| 1035 | { |
|---|
| 1036 | B=filters[filter_type].B; |
|---|
| 1037 | C=filters[filter_type].C; |
|---|
| 1038 | if (filters[window_type].function == CubicBC) |
|---|
| 1039 | { |
|---|
| 1040 | B=filters[window_type].B; |
|---|
| 1041 | C=filters[window_type].C; |
|---|
| 1042 | } |
|---|
| 1043 | artifact=GetImageArtifact(image,"filter:b"); |
|---|
| 1044 | if (artifact != (const char *) NULL) |
|---|
| 1045 | { |
|---|
| 1046 | B=StringToDouble(artifact,(char **) NULL); |
|---|
| 1047 | C=(1.0-B)/2.0; /* Calculate C to get a Keys cubic filter. */ |
|---|
| 1048 | artifact=GetImageArtifact(image,"filter:c"); /* user C override */ |
|---|
| 1049 | if (artifact != (const char *) NULL) |
|---|
| 1050 | C=StringToDouble(artifact,(char **) NULL); |
|---|
| 1051 | } |
|---|
| 1052 | else |
|---|
| 1053 | { |
|---|
| 1054 | artifact=GetImageArtifact(image,"filter:c"); |
|---|
| 1055 | if (artifact != (const char *) NULL) |
|---|
| 1056 | { |
|---|
| 1057 | C=StringToDouble(artifact,(char **) NULL); |
|---|
| 1058 | B=1.0-2.0*C; /* Calculate B to get a Keys cubic filter. */ |
|---|
| 1059 | } |
|---|
| 1060 | } |
|---|
| 1061 | /* Convert B,C values into Cubic Coefficents. See CubicBC(). */ |
|---|
| 1062 | { |
|---|
| 1063 | const double twoB = B+B; |
|---|
| 1064 | resize_filter->coefficient[0]=1.0-(1.0/3.0)*B; |
|---|
| 1065 | resize_filter->coefficient[1]=-3.0+twoB+C; |
|---|
| 1066 | resize_filter->coefficient[2]=2.0-1.5*B-C; |
|---|
| 1067 | resize_filter->coefficient[3]=(4.0/3.0)*B+4.0*C; |
|---|
| 1068 | resize_filter->coefficient[4]=-8.0*C-twoB; |
|---|
| 1069 | resize_filter->coefficient[5]=B+5.0*C; |
|---|
| 1070 | resize_filter->coefficient[6]=(-1.0/6.0)*B-C; |
|---|
| 1071 | } |
|---|
| 1072 | } |
|---|
| 1073 | |
|---|
| 1074 | /* |
|---|
| 1075 | Expert Option Request for verbose details of the resulting filter. |
|---|
| 1076 | */ |
|---|
| 1077 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
|---|
| 1078 | #pragma omp master |
|---|
| 1079 | { |
|---|
| 1080 | #endif |
|---|
| 1081 | if (IfStringTrue(GetImageArtifact(image,"filter:verbose"))) |
|---|
| 1082 | { |
|---|
| 1083 | double |
|---|
| 1084 | support, |
|---|
| 1085 | x; |
|---|
| 1086 | |
|---|
| 1087 | /* |
|---|
| 1088 | Set the weighting function properly when the weighting |
|---|
| 1089 | function may not exactly match the filter of the same name. |
|---|
| 1090 | EG: a Point filter is really uses a Box weighting function |
|---|
| 1091 | with a different support than is typically used. |
|---|
| 1092 | */ |
|---|
| 1093 | if (resize_filter->filter == Box) filter_type=BoxFilter; |
|---|
| 1094 | if (resize_filter->filter == Sinc) filter_type=SincFilter; |
|---|
| 1095 | if (resize_filter->filter == SincFast) filter_type=SincFastFilter; |
|---|
| 1096 | if (resize_filter->filter == Jinc) filter_type=JincFilter; |
|---|
| 1097 | if (resize_filter->filter == CubicBC) filter_type=CubicFilter; |
|---|
| 1098 | if (resize_filter->window == Box) window_type=BoxFilter; |
|---|
| 1099 | if (resize_filter->window == Sinc) window_type=SincFilter; |
|---|
| 1100 | if (resize_filter->window == SincFast) window_type=SincFastFilter; |
|---|
| 1101 | if (resize_filter->window == Jinc) window_type=JincFilter; |
|---|
| 1102 | if (resize_filter->window == CubicBC) window_type=CubicFilter; |
|---|
| 1103 | /* |
|---|
| 1104 | Report Filter Details. |
|---|
| 1105 | */ |
|---|
| 1106 | support=GetResizeFilterSupport(resize_filter); /* practical_support */ |
|---|
| 1107 | (void) FormatLocaleFile(stdout,"# Resize Filter (for graphing)\n#\n"); |
|---|
| 1108 | (void) FormatLocaleFile(stdout,"# filter = %s\n", |
|---|
| 1109 | CommandOptionToMnemonic(MagickFilterOptions,filter_type)); |
|---|
| 1110 | (void) FormatLocaleFile(stdout,"# window = %s\n", |
|---|
| 1111 | CommandOptionToMnemonic(MagickFilterOptions, window_type)); |
|---|
| 1112 | (void) FormatLocaleFile(stdout,"# support = %.*g\n", |
|---|
| 1113 | GetMagickPrecision(),(double) resize_filter->support); |
|---|
| 1114 | (void) FormatLocaleFile(stdout,"# win-support = %.*g\n", |
|---|
| 1115 | GetMagickPrecision(),(double) resize_filter->window_support); |
|---|
| 1116 | (void) FormatLocaleFile(stdout,"# scale_blur = %.*g\n", |
|---|
| 1117 | GetMagickPrecision(), (double)resize_filter->blur); |
|---|
| 1118 | if ( filter_type == GaussianFilter ) |
|---|
| 1119 | (void) FormatLocaleFile(stdout,"# gaussian_sigma = %.*g\n", |
|---|
| 1120 | GetMagickPrecision(), (double)resize_filter->coefficient[0]); |
|---|
| 1121 | if ( filter_type == KaiserFilter ) |
|---|
| 1122 | (void) FormatLocaleFile(stdout,"# kaiser_alpha = %.*g\n", |
|---|
| 1123 | GetMagickPrecision(), (double)resize_filter->coefficient[0]); |
|---|
| 1124 | (void) FormatLocaleFile(stdout,"# practical_support = %.*g\n", |
|---|
| 1125 | GetMagickPrecision(), (double)support); |
|---|
| 1126 | if ( filter_type == CubicFilter || window_type == CubicFilter ) |
|---|
| 1127 | (void) FormatLocaleFile(stdout,"# B,C = %.*g,%.*g\n", |
|---|
| 1128 | GetMagickPrecision(),(double)B, GetMagickPrecision(),(double)C); |
|---|
| 1129 | (void) FormatLocaleFile(stdout,"\n"); |
|---|
| 1130 | /* |
|---|
| 1131 | Output values of resulting filter graph -- for graphing |
|---|
| 1132 | filter result. |
|---|
| 1133 | */ |
|---|
| 1134 | for (x=0.0; x <= support; x+=0.01f) |
|---|
| 1135 | (void) FormatLocaleFile(stdout,"%5.2lf\t%.*g\n",x,GetMagickPrecision(), |
|---|
| 1136 | (double) GetResizeFilterWeight(resize_filter,x)); |
|---|
| 1137 | /* A final value so gnuplot can graph the 'stop' properly. */ |
|---|
| 1138 | (void) FormatLocaleFile(stdout,"%5.2lf\t%.*g\n",support, |
|---|
| 1139 | GetMagickPrecision(),0.0); |
|---|
| 1140 | } |
|---|
| 1141 | /* Output the above once only for each image - remove setting */ |
|---|
| 1142 | (void) DeleteImageArtifact((Image *) image,"filter:verbose"); |
|---|
| 1143 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
|---|
| 1144 | } |
|---|
| 1145 | #endif |
|---|
| 1146 | return(resize_filter); |
|---|
| 1147 | } |
|---|
| 1148 | |
|---|
| 1149 | /* |
|---|
| 1150 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1151 | % % |
|---|
| 1152 | % % |
|---|
| 1153 | % % |
|---|
| 1154 | % A d a p t i v e R e s i z e I m a g e % |
|---|
| 1155 | % % |
|---|
| 1156 | % % |
|---|
| 1157 | % % |
|---|
| 1158 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1159 | % |
|---|
| 1160 | % AdaptiveResizeImage() adaptively resize image with pixel resampling. |
|---|
| 1161 | % |
|---|
| 1162 | % This is shortcut function for a fast interpolative resize using mesh |
|---|
| 1163 | % interpolation. It works well for small resizes of less than +/- 50% |
|---|
| 1164 | % of the original image size. For larger resizing on images a full |
|---|
| 1165 | % filtered and slower resize function should be used instead. |
|---|
| 1166 | % |
|---|
| 1167 | % The format of the AdaptiveResizeImage method is: |
|---|
| 1168 | % |
|---|
| 1169 | % Image *AdaptiveResizeImage(const Image *image,const size_t columns, |
|---|
| 1170 | % const size_t rows, ExceptionInfo *exception) |
|---|
| 1171 | % |
|---|
| 1172 | % A description of each parameter follows: |
|---|
| 1173 | % |
|---|
| 1174 | % o image: the image. |
|---|
| 1175 | % |
|---|
| 1176 | % o columns: the number of columns in the resized image. |
|---|
| 1177 | % |
|---|
| 1178 | % o rows: the number of rows in the resized image. |
|---|
| 1179 | % |
|---|
| 1180 | % o exception: return any errors or warnings in this structure. |
|---|
| 1181 | % |
|---|
| 1182 | */ |
|---|
| 1183 | MagickExport Image *AdaptiveResizeImage(const Image *image, |
|---|
| 1184 | const size_t columns,const size_t rows,ExceptionInfo *exception) |
|---|
| 1185 | { |
|---|
| 1186 | Image |
|---|
| 1187 | *resize_image; |
|---|
| 1188 | |
|---|
| 1189 | resize_image=InterpolativeResizeImage(image,columns,rows,MeshInterpolatePixel, |
|---|
| 1190 | exception); |
|---|
| 1191 | return(resize_image); |
|---|
| 1192 | } |
|---|
| 1193 | |
|---|
| 1194 | /* |
|---|
| 1195 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1196 | % % |
|---|
| 1197 | % % |
|---|
| 1198 | % % |
|---|
| 1199 | + B e s s e l O r d e r O n e % |
|---|
| 1200 | % % |
|---|
| 1201 | % % |
|---|
| 1202 | % % |
|---|
| 1203 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1204 | % |
|---|
| 1205 | % BesselOrderOne() computes the Bessel function of x of the first kind of |
|---|
| 1206 | % order 0. This is used to create the Jinc() filter function below. |
|---|
| 1207 | % |
|---|
| 1208 | % Reduce x to |x| since j1(x)= -j1(-x), and for x in (0,8] |
|---|
| 1209 | % |
|---|
| 1210 | % j1(x) = x*j1(x); |
|---|
| 1211 | % |
|---|
| 1212 | % For x in (8,inf) |
|---|
| 1213 | % |
|---|
| 1214 | % j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x1)-q1(x)*sin(x1)) |
|---|
| 1215 | % |
|---|
| 1216 | % where x1 = x-3*pi/4. Compute sin(x1) and cos(x1) as follow: |
|---|
| 1217 | % |
|---|
| 1218 | % cos(x1) = cos(x)cos(3pi/4)+sin(x)sin(3pi/4) |
|---|
| 1219 | % = 1/sqrt(2) * (sin(x) - cos(x)) |
|---|
| 1220 | % sin(x1) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4) |
|---|
| 1221 | % = -1/sqrt(2) * (sin(x) + cos(x)) |
|---|
| 1222 | % |
|---|
| 1223 | % The format of the BesselOrderOne method is: |
|---|
| 1224 | % |
|---|
| 1225 | % MagickRealType BesselOrderOne(MagickRealType x) |
|---|
| 1226 | % |
|---|
| 1227 | % A description of each parameter follows: |
|---|
| 1228 | % |
|---|
| 1229 | % o x: MagickRealType value. |
|---|
| 1230 | % |
|---|
| 1231 | */ |
|---|
| 1232 | |
|---|
| 1233 | #undef I0 |
|---|
| 1234 | static MagickRealType I0(MagickRealType x) |
|---|
| 1235 | { |
|---|
| 1236 | MagickRealType |
|---|
| 1237 | sum, |
|---|
| 1238 | t, |
|---|
| 1239 | y; |
|---|
| 1240 | |
|---|
| 1241 | register ssize_t |
|---|
| 1242 | i; |
|---|
| 1243 | |
|---|
| 1244 | /* |
|---|
| 1245 | Zeroth order Bessel function of the first kind. |
|---|
| 1246 | */ |
|---|
| 1247 | sum=1.0; |
|---|
| 1248 | y=x*x/4.0; |
|---|
| 1249 | t=y; |
|---|
| 1250 | for (i=2; t > MagickEpsilon; i++) |
|---|
| 1251 | { |
|---|
| 1252 | sum+=t; |
|---|
| 1253 | t*=y/((MagickRealType) i*i); |
|---|
| 1254 | } |
|---|
| 1255 | return(sum); |
|---|
| 1256 | } |
|---|
| 1257 | |
|---|
| 1258 | #undef J1 |
|---|
| 1259 | static MagickRealType J1(MagickRealType x) |
|---|
| 1260 | { |
|---|
| 1261 | MagickRealType |
|---|
| 1262 | p, |
|---|
| 1263 | q; |
|---|
| 1264 | |
|---|
| 1265 | register ssize_t |
|---|
| 1266 | i; |
|---|
| 1267 | |
|---|
| 1268 | static const double |
|---|
| 1269 | Pone[] = |
|---|
| 1270 | { |
|---|
| 1271 | 0.581199354001606143928050809e+21, |
|---|
| 1272 | -0.6672106568924916298020941484e+20, |
|---|
| 1273 | 0.2316433580634002297931815435e+19, |
|---|
| 1274 | -0.3588817569910106050743641413e+17, |
|---|
| 1275 | 0.2908795263834775409737601689e+15, |
|---|
| 1276 | -0.1322983480332126453125473247e+13, |
|---|
| 1277 | 0.3413234182301700539091292655e+10, |
|---|
| 1278 | -0.4695753530642995859767162166e+7, |
|---|
| 1279 | 0.270112271089232341485679099e+4 |
|---|
| 1280 | }, |
|---|
| 1281 | Qone[] = |
|---|
| 1282 | { |
|---|
| 1283 | 0.11623987080032122878585294e+22, |
|---|
| 1284 | 0.1185770712190320999837113348e+20, |
|---|
| 1285 | 0.6092061398917521746105196863e+17, |
|---|
| 1286 | 0.2081661221307607351240184229e+15, |
|---|
| 1287 | 0.5243710262167649715406728642e+12, |
|---|
| 1288 | 0.1013863514358673989967045588e+10, |
|---|
| 1289 | 0.1501793594998585505921097578e+7, |
|---|
| 1290 | 0.1606931573481487801970916749e+4, |
|---|
| 1291 | 0.1e+1 |
|---|
| 1292 | }; |
|---|
| 1293 | |
|---|
| 1294 | p=Pone[8]; |
|---|
| 1295 | q=Qone[8]; |
|---|
| 1296 | for (i=7; i >= 0; i--) |
|---|
| 1297 | { |
|---|
| 1298 | p=p*x*x+Pone[i]; |
|---|
| 1299 | q=q*x*x+Qone[i]; |
|---|
| 1300 | } |
|---|
| 1301 | return(p/q); |
|---|
| 1302 | } |
|---|
| 1303 | |
|---|
| 1304 | #undef P1 |
|---|
| 1305 | static MagickRealType P1(MagickRealType x) |
|---|
| 1306 | { |
|---|
| 1307 | MagickRealType |
|---|
| 1308 | p, |
|---|
| 1309 | q; |
|---|
| 1310 | |
|---|
| 1311 | register ssize_t |
|---|
| 1312 | i; |
|---|
| 1313 | |
|---|
| 1314 | static const double |
|---|
| 1315 | Pone[] = |
|---|
| 1316 | { |
|---|
| 1317 | 0.352246649133679798341724373e+5, |
|---|
| 1318 | 0.62758845247161281269005675e+5, |
|---|
| 1319 | 0.313539631109159574238669888e+5, |
|---|
| 1320 | 0.49854832060594338434500455e+4, |
|---|
| 1321 | 0.2111529182853962382105718e+3, |
|---|
| 1322 | 0.12571716929145341558495e+1 |
|---|
| 1323 | }, |
|---|
| 1324 | Qone[] = |
|---|
| 1325 | { |
|---|
| 1326 | 0.352246649133679798068390431e+5, |
|---|
| 1327 | 0.626943469593560511888833731e+5, |
|---|
| 1328 | 0.312404063819041039923015703e+5, |
|---|
| 1329 | 0.4930396490181088979386097e+4, |
|---|
| 1330 | 0.2030775189134759322293574e+3, |
|---|
| 1331 | 0.1e+1 |
|---|
| 1332 | }; |
|---|
| 1333 | |
|---|
| 1334 | p=Pone[5]; |
|---|
| 1335 | q=Qone[5]; |
|---|
| 1336 | for (i=4; i >= 0; i--) |
|---|
| 1337 | { |
|---|
| 1338 | p=p*(8.0/x)*(8.0/x)+Pone[i]; |
|---|
| 1339 | q=q*(8.0/x)*(8.0/x)+Qone[i]; |
|---|
| 1340 | } |
|---|
| 1341 | return(p/q); |
|---|
| 1342 | } |
|---|
| 1343 | |
|---|
| 1344 | #undef Q1 |
|---|
| 1345 | static MagickRealType Q1(MagickRealType x) |
|---|
| 1346 | { |
|---|
| 1347 | MagickRealType |
|---|
| 1348 | p, |
|---|
| 1349 | q; |
|---|
| 1350 | |
|---|
| 1351 | register ssize_t |
|---|
| 1352 | i; |
|---|
| 1353 | |
|---|
| 1354 | static const double |
|---|
| 1355 | Pone[] = |
|---|
| 1356 | { |
|---|
| 1357 | 0.3511751914303552822533318e+3, |
|---|
| 1358 | 0.7210391804904475039280863e+3, |
|---|
| 1359 | 0.4259873011654442389886993e+3, |
|---|
| 1360 | 0.831898957673850827325226e+2, |
|---|
| 1361 | 0.45681716295512267064405e+1, |
|---|
| 1362 | 0.3532840052740123642735e-1 |
|---|
| 1363 | }, |
|---|
| 1364 | Qone[] = |
|---|
| 1365 | { |
|---|
| 1366 | 0.74917374171809127714519505e+4, |
|---|
| 1367 | 0.154141773392650970499848051e+5, |
|---|
| 1368 | 0.91522317015169922705904727e+4, |
|---|
| 1369 | 0.18111867005523513506724158e+4, |
|---|
| 1370 | 0.1038187585462133728776636e+3, |
|---|
| 1371 | 0.1e+1 |
|---|
| 1372 | }; |
|---|
| 1373 | |
|---|
| 1374 | p=Pone[5]; |
|---|
| 1375 | q=Qone[5]; |
|---|
| 1376 | for (i=4; i >= 0; i--) |
|---|
| 1377 | { |
|---|
| 1378 | p=p*(8.0/x)*(8.0/x)+Pone[i]; |
|---|
| 1379 | q=q*(8.0/x)*(8.0/x)+Qone[i]; |
|---|
| 1380 | } |
|---|
| 1381 | return(p/q); |
|---|
| 1382 | } |
|---|
| 1383 | |
|---|
| 1384 | static MagickRealType BesselOrderOne(MagickRealType x) |
|---|
| 1385 | { |
|---|
| 1386 | MagickRealType |
|---|
| 1387 | p, |
|---|
| 1388 | q; |
|---|
| 1389 | |
|---|
| 1390 | if (x == 0.0) |
|---|
| 1391 | return(0.0); |
|---|
| 1392 | p=x; |
|---|
| 1393 | if (x < 0.0) |
|---|
| 1394 | x=(-x); |
|---|
| 1395 | if (x < 8.0) |
|---|
| 1396 | return(p*J1(x)); |
|---|
| 1397 | q=sqrt((double) (2.0/(MagickPI*x)))*(P1(x)*(1.0/sqrt(2.0)*(sin((double) x)- |
|---|
| 1398 | cos((double) x)))-8.0/x*Q1(x)*(-1.0/sqrt(2.0)*(sin((double) x)+ |
|---|
| 1399 | cos((double) x)))); |
|---|
| 1400 | if (p < 0.0) |
|---|
| 1401 | q=(-q); |
|---|
| 1402 | return(q); |
|---|
| 1403 | } |
|---|
| 1404 | |
|---|
| 1405 | /* |
|---|
| 1406 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1407 | % % |
|---|
| 1408 | % % |
|---|
| 1409 | % % |
|---|
| 1410 | + D e s t r o y R e s i z e F i l t e r % |
|---|
| 1411 | % % |
|---|
| 1412 | % % |
|---|
| 1413 | % % |
|---|
| 1414 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1415 | % |
|---|
| 1416 | % DestroyResizeFilter() destroy the resize filter. |
|---|
| 1417 | % |
|---|
| 1418 | % The format of the DestroyResizeFilter method is: |
|---|
| 1419 | % |
|---|
| 1420 | % ResizeFilter *DestroyResizeFilter(ResizeFilter *resize_filter) |
|---|
| 1421 | % |
|---|
| 1422 | % A description of each parameter follows: |
|---|
| 1423 | % |
|---|
| 1424 | % o resize_filter: the resize filter. |
|---|
| 1425 | % |
|---|
| 1426 | */ |
|---|
| 1427 | MagickPrivate ResizeFilter *DestroyResizeFilter(ResizeFilter *resize_filter) |
|---|
| 1428 | { |
|---|
| 1429 | assert(resize_filter != (ResizeFilter *) NULL); |
|---|
| 1430 | assert(resize_filter->signature == MagickSignature); |
|---|
| 1431 | resize_filter->signature=(~MagickSignature); |
|---|
| 1432 | resize_filter=(ResizeFilter *) RelinquishMagickMemory(resize_filter); |
|---|
| 1433 | return(resize_filter); |
|---|
| 1434 | } |
|---|
| 1435 | |
|---|
| 1436 | /* |
|---|
| 1437 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1438 | % % |
|---|
| 1439 | % % |
|---|
| 1440 | % % |
|---|
| 1441 | + G e t R e s i z e F i l t e r S u p p o r t % |
|---|
| 1442 | % % |
|---|
| 1443 | % % |
|---|
| 1444 | % % |
|---|
| 1445 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1446 | % |
|---|
| 1447 | % GetResizeFilterSupport() return the current support window size for this |
|---|
| 1448 | % filter. Note that this may have been enlarged by filter:blur factor. |
|---|
| 1449 | % |
|---|
| 1450 | % The format of the GetResizeFilterSupport method is: |
|---|
| 1451 | % |
|---|
| 1452 | % MagickRealType GetResizeFilterSupport(const ResizeFilter *resize_filter) |
|---|
| 1453 | % |
|---|
| 1454 | % A description of each parameter follows: |
|---|
| 1455 | % |
|---|
| 1456 | % o filter: Image filter to use. |
|---|
| 1457 | % |
|---|
| 1458 | */ |
|---|
| 1459 | MagickPrivate MagickRealType GetResizeFilterSupport( |
|---|
| 1460 | const ResizeFilter *resize_filter) |
|---|
| 1461 | { |
|---|
| 1462 | assert(resize_filter != (ResizeFilter *) NULL); |
|---|
| 1463 | assert(resize_filter->signature == MagickSignature); |
|---|
| 1464 | return(resize_filter->support*resize_filter->blur); |
|---|
| 1465 | } |
|---|
| 1466 | |
|---|
| 1467 | /* |
|---|
| 1468 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1469 | % % |
|---|
| 1470 | % % |
|---|
| 1471 | % % |
|---|
| 1472 | + G e t R e s i z e F i l t e r W e i g h t % |
|---|
| 1473 | % % |
|---|
| 1474 | % % |
|---|
| 1475 | % % |
|---|
| 1476 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1477 | % |
|---|
| 1478 | % GetResizeFilterWeight evaluates the specified resize filter at the point x |
|---|
| 1479 | % which usally lies between zero and the filters current 'support' and |
|---|
| 1480 | % returns the weight of the filter function at that point. |
|---|
| 1481 | % |
|---|
| 1482 | % The format of the GetResizeFilterWeight method is: |
|---|
| 1483 | % |
|---|
| 1484 | % MagickRealType GetResizeFilterWeight(const ResizeFilter *resize_filter, |
|---|
| 1485 | % const MagickRealType x) |
|---|
| 1486 | % |
|---|
| 1487 | % A description of each parameter follows: |
|---|
| 1488 | % |
|---|
| 1489 | % o filter: the filter type. |
|---|
| 1490 | % |
|---|
| 1491 | % o x: the point. |
|---|
| 1492 | % |
|---|
| 1493 | */ |
|---|
| 1494 | MagickPrivate MagickRealType GetResizeFilterWeight( |
|---|
| 1495 | const ResizeFilter *resize_filter,const MagickRealType x) |
|---|
| 1496 | { |
|---|
| 1497 | MagickRealType |
|---|
| 1498 | scale, |
|---|
| 1499 | weight, |
|---|
| 1500 | x_blur; |
|---|
| 1501 | |
|---|
| 1502 | /* |
|---|
| 1503 | Windowing function - scale the weighting filter by this amount. |
|---|
| 1504 | */ |
|---|
| 1505 | assert(resize_filter != (ResizeFilter *) NULL); |
|---|
| 1506 | assert(resize_filter->signature == MagickSignature); |
|---|
| 1507 | x_blur=fabs((double) x)/resize_filter->blur; /* X offset with blur scaling */ |
|---|
| 1508 | if ((resize_filter->window_support < MagickEpsilon) || |
|---|
| 1509 | (resize_filter->window == Box)) |
|---|
| 1510 | scale=1.0; /* Point or Box Filter -- avoid division by zero */ |
|---|
| 1511 | else |
|---|
| 1512 | { |
|---|
| 1513 | scale=resize_filter->scale; |
|---|
| 1514 | scale=resize_filter->window(x_blur*scale,resize_filter); |
|---|
| 1515 | } |
|---|
| 1516 | weight=scale*resize_filter->filter(x_blur,resize_filter); |
|---|
| 1517 | return(weight); |
|---|
| 1518 | } |
|---|
| 1519 | |
|---|
| 1520 | /* |
|---|
| 1521 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1522 | % % |
|---|
| 1523 | % % |
|---|
| 1524 | % % |
|---|
| 1525 | % I n t e r p o l a t i v e R e s i z e I m a g e % |
|---|
| 1526 | % % |
|---|
| 1527 | % % |
|---|
| 1528 | % % |
|---|
| 1529 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1530 | % |
|---|
| 1531 | % InterpolativeResizeImage() resizes an image using the specified |
|---|
| 1532 | % interpolation method. |
|---|
| 1533 | % |
|---|
| 1534 | % The format of the InterpolativeResizeImage method is: |
|---|
| 1535 | % |
|---|
| 1536 | % Image *InterpolativeResizeImage(const Image *image,const size_t columns, |
|---|
| 1537 | % const size_t rows,const PixelInterpolateMethod method, |
|---|
| 1538 | % ExceptionInfo *exception) |
|---|
| 1539 | % |
|---|
| 1540 | % A description of each parameter follows: |
|---|
| 1541 | % |
|---|
| 1542 | % o image: the image. |
|---|
| 1543 | % |
|---|
| 1544 | % o columns: the number of columns in the resized image. |
|---|
| 1545 | % |
|---|
| 1546 | % o rows: the number of rows in the resized image. |
|---|
| 1547 | % |
|---|
| 1548 | % o method: the pixel interpolation method. |
|---|
| 1549 | % |
|---|
| 1550 | % o exception: return any errors or warnings in this structure. |
|---|
| 1551 | % |
|---|
| 1552 | */ |
|---|
| 1553 | MagickExport Image *InterpolativeResizeImage(const Image *image, |
|---|
| 1554 | const size_t columns,const size_t rows,const PixelInterpolateMethod method, |
|---|
| 1555 | ExceptionInfo *exception) |
|---|
| 1556 | { |
|---|
| 1557 | #define InterpolativeResizeImageTag "Resize/Image" |
|---|
| 1558 | |
|---|
| 1559 | CacheView |
|---|
| 1560 | *image_view, |
|---|
| 1561 | *resize_view; |
|---|
| 1562 | |
|---|
| 1563 | Image |
|---|
| 1564 | *resize_image; |
|---|
| 1565 | |
|---|
| 1566 | MagickBooleanType |
|---|
| 1567 | status; |
|---|
| 1568 | |
|---|
| 1569 | MagickOffsetType |
|---|
| 1570 | progress; |
|---|
| 1571 | |
|---|
| 1572 | PointInfo |
|---|
| 1573 | scale; |
|---|
| 1574 | |
|---|
| 1575 | ssize_t |
|---|
| 1576 | y; |
|---|
| 1577 | |
|---|
| 1578 | /* |
|---|
| 1579 | Interpolatively resize image. |
|---|
| 1580 | */ |
|---|
| 1581 | assert(image != (const Image *) NULL); |
|---|
| 1582 | assert(image->signature == MagickSignature); |
|---|
| 1583 | if( IfMagickTrue(image->debug) ) |
|---|
| 1584 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
|---|
| 1585 | assert(exception != (ExceptionInfo *) NULL); |
|---|
| 1586 | assert(exception->signature == MagickSignature); |
|---|
| 1587 | if ((columns == 0) || (rows == 0)) |
|---|
| 1588 | return((Image *) NULL); |
|---|
| 1589 | if ((columns == image->columns) && (rows == image->rows)) |
|---|
| 1590 | return(CloneImage(image,0,0,MagickTrue,exception)); |
|---|
| 1591 | resize_image=CloneImage(image,columns,rows,MagickTrue,exception); |
|---|
| 1592 | if (resize_image == (Image *) NULL) |
|---|
| 1593 | return((Image *) NULL); |
|---|
| 1594 | if( IfMagickFalse(SetImageStorageClass(resize_image,DirectClass,exception)) ) |
|---|
| 1595 | { |
|---|
| 1596 | resize_image=DestroyImage(resize_image); |
|---|
| 1597 | return((Image *) NULL); |
|---|
| 1598 | } |
|---|
| 1599 | status=MagickTrue; |
|---|
| 1600 | progress=0; |
|---|
| 1601 | image_view=AcquireVirtualCacheView(image,exception); |
|---|
| 1602 | resize_view=AcquireAuthenticCacheView(resize_image,exception); |
|---|
| 1603 | scale.x=(double) image->columns/resize_image->columns; |
|---|
| 1604 | scale.y=(double) image->rows/resize_image->rows; |
|---|
| 1605 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
|---|
| 1606 | #pragma omp parallel for schedule(static) shared(progress,status) \ |
|---|
| 1607 | dynamic_number_threads(image->columns,image->rows,1) |
|---|
| 1608 | #endif |
|---|
| 1609 | for (y=0; y < (ssize_t) resize_image->rows; y++) |
|---|
| 1610 | { |
|---|
| 1611 | PointInfo |
|---|
| 1612 | offset; |
|---|
| 1613 | |
|---|
| 1614 | register Quantum |
|---|
| 1615 | *restrict q; |
|---|
| 1616 | |
|---|
| 1617 | register ssize_t |
|---|
| 1618 | x; |
|---|
| 1619 | |
|---|
| 1620 | if( IfMagickFalse(status) ) |
|---|
| 1621 | continue; |
|---|
| 1622 | q=QueueCacheViewAuthenticPixels(resize_view,0,y,resize_image->columns,1, |
|---|
| 1623 | exception); |
|---|
| 1624 | if (q == (Quantum *) NULL) |
|---|
| 1625 | continue; |
|---|
| 1626 | offset.y=((MagickRealType) y+0.5)*scale.y-0.5; |
|---|
| 1627 | for (x=0; x < (ssize_t) resize_image->columns; x++) |
|---|
| 1628 | { |
|---|
| 1629 | register ssize_t |
|---|
| 1630 | i; |
|---|
| 1631 | |
|---|
| 1632 | if (GetPixelMask(resize_image,q) != 0) |
|---|
| 1633 | { |
|---|
| 1634 | q+=GetPixelChannels(resize_image); |
|---|
| 1635 | continue; |
|---|
| 1636 | } |
|---|
| 1637 | for (i=0; i < (ssize_t) GetPixelChannels(resize_image); i++) |
|---|
| 1638 | { |
|---|
| 1639 | PixelChannel |
|---|
| 1640 | channel; |
|---|
| 1641 | |
|---|
| 1642 | PixelTrait |
|---|
| 1643 | resize_traits, |
|---|
| 1644 | traits; |
|---|
| 1645 | |
|---|
| 1646 | channel=GetPixelChannelMapChannel(image,i); |
|---|
| 1647 | traits=GetPixelChannelMapTraits(image,channel); |
|---|
| 1648 | resize_traits=GetPixelChannelMapTraits(resize_image,channel); |
|---|
| 1649 | if ((traits == UndefinedPixelTrait) || |
|---|
| 1650 | (resize_traits == UndefinedPixelTrait)) |
|---|
| 1651 | continue; |
|---|
| 1652 | offset.x=((MagickRealType) x+0.5)*scale.x-0.5; |
|---|
| 1653 | status=InterpolatePixelChannels(image,image_view,resize_image,method, |
|---|
| 1654 | offset.x,offset.y,q,exception); |
|---|
| 1655 | } |
|---|
| 1656 | q+=GetPixelChannels(resize_image); |
|---|
| 1657 | } |
|---|
| 1658 | if( IfMagickFalse(SyncCacheViewAuthenticPixels(resize_view,exception)) ) |
|---|
| 1659 | continue; |
|---|
| 1660 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
|---|
| 1661 | { |
|---|
| 1662 | MagickBooleanType |
|---|
| 1663 | proceed; |
|---|
| 1664 | |
|---|
| 1665 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
|---|
| 1666 | #pragma omp critical (MagickCore_InterpolativeResizeImage) |
|---|
| 1667 | #endif |
|---|
| 1668 | proceed=SetImageProgress(image,InterpolativeResizeImageTag,progress++, |
|---|
| 1669 | image->rows); |
|---|
| 1670 | if( IfMagickFalse(proceed) ) |
|---|
| 1671 | status=MagickFalse; |
|---|
| 1672 | } |
|---|
| 1673 | } |
|---|
| 1674 | resize_view=DestroyCacheView(resize_view); |
|---|
| 1675 | image_view=DestroyCacheView(image_view); |
|---|
| 1676 | if( IfMagickFalse(status) ) |
|---|
| 1677 | resize_image=DestroyImage(resize_image); |
|---|
| 1678 | return(resize_image); |
|---|
| 1679 | } |
|---|
| 1680 | #if defined(MAGICKCORE_LQR_DELEGATE) |
|---|
| 1681 | |
|---|
| 1682 | /* |
|---|
| 1683 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1684 | % % |
|---|
| 1685 | % % |
|---|
| 1686 | % % |
|---|
| 1687 | % L i q u i d R e s c a l e I m a g e % |
|---|
| 1688 | % % |
|---|
| 1689 | % % |
|---|
| 1690 | % % |
|---|
| 1691 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1692 | % |
|---|
| 1693 | % LiquidRescaleImage() rescales image with seam carving. |
|---|
| 1694 | % |
|---|
| 1695 | % The format of the LiquidRescaleImage method is: |
|---|
| 1696 | % |
|---|
| 1697 | % Image *LiquidRescaleImage(const Image *image,const size_t columns, |
|---|
| 1698 | % const size_t rows,const double delta_x,const double rigidity, |
|---|
| 1699 | % ExceptionInfo *exception) |
|---|
| 1700 | % |
|---|
| 1701 | % A description of each parameter follows: |
|---|
| 1702 | % |
|---|
| 1703 | % o image: the image. |
|---|
| 1704 | % |
|---|
| 1705 | % o columns: the number of columns in the rescaled image. |
|---|
| 1706 | % |
|---|
| 1707 | % o rows: the number of rows in the rescaled image. |
|---|
| 1708 | % |
|---|
| 1709 | % o delta_x: maximum seam transversal step (0 means straight seams). |
|---|
| 1710 | % |
|---|
| 1711 | % o rigidity: introduce a bias for non-straight seams (typically 0). |
|---|
| 1712 | % |
|---|
| 1713 | % o exception: return any errors or warnings in this structure. |
|---|
| 1714 | % |
|---|
| 1715 | */ |
|---|
| 1716 | MagickExport Image *LiquidRescaleImage(const Image *image,const size_t columns, |
|---|
| 1717 | const size_t rows,const double delta_x,const double rigidity, |
|---|
| 1718 | ExceptionInfo *exception) |
|---|
| 1719 | { |
|---|
| 1720 | #define LiquidRescaleImageTag "Rescale/Image" |
|---|
| 1721 | |
|---|
| 1722 | CacheView |
|---|
| 1723 | *image_view, |
|---|
| 1724 | *rescale_view; |
|---|
| 1725 | |
|---|
| 1726 | gfloat |
|---|
| 1727 | *packet, |
|---|
| 1728 | *pixels; |
|---|
| 1729 | |
|---|
| 1730 | Image |
|---|
| 1731 | *rescale_image; |
|---|
| 1732 | |
|---|
| 1733 | int |
|---|
| 1734 | x_offset, |
|---|
| 1735 | y_offset; |
|---|
| 1736 | |
|---|
| 1737 | LqrCarver |
|---|
| 1738 | *carver; |
|---|
| 1739 | |
|---|
| 1740 | LqrRetVal |
|---|
| 1741 | lqr_status; |
|---|
| 1742 | |
|---|
| 1743 | MagickBooleanType |
|---|
| 1744 | status; |
|---|
| 1745 | |
|---|
| 1746 | register gfloat |
|---|
| 1747 | *q; |
|---|
| 1748 | |
|---|
| 1749 | ssize_t |
|---|
| 1750 | y; |
|---|
| 1751 | |
|---|
| 1752 | /* |
|---|
| 1753 | Liquid rescale image. |
|---|
| 1754 | */ |
|---|
| 1755 | assert(image != (const Image *) NULL); |
|---|
| 1756 | assert(image->signature == MagickSignature); |
|---|
| 1757 | if( IfMagickTrue(image->debug) ) |
|---|
| 1758 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
|---|
| 1759 | assert(exception != (ExceptionInfo *) NULL); |
|---|
| 1760 | assert(exception->signature == MagickSignature); |
|---|
| 1761 | if ((columns == 0) || (rows == 0)) |
|---|
| 1762 | return((Image *) NULL); |
|---|
| 1763 | if ((columns == image->columns) && (rows == image->rows)) |
|---|
| 1764 | return(CloneImage(image,0,0,MagickTrue,exception)); |
|---|
| 1765 | if ((columns <= 2) || (rows <= 2)) |
|---|
| 1766 | return(ResizeImage(image,columns,rows,image->filter,exception)); |
|---|
| 1767 | if ((columns >= (2*image->columns)) || (rows >= (2*image->rows))) |
|---|
| 1768 | { |
|---|
| 1769 | Image |
|---|
| 1770 | *resize_image; |
|---|
| 1771 | |
|---|
| 1772 | size_t |
|---|
| 1773 | height, |
|---|
| 1774 | width; |
|---|
| 1775 | |
|---|
| 1776 | /* |
|---|
| 1777 | Honor liquid resize size limitations. |
|---|
| 1778 | */ |
|---|
| 1779 | for (width=image->columns; columns >= (2*width-1); width*=2); |
|---|
| 1780 | for (height=image->rows; rows >= (2*height-1); height*=2); |
|---|
| 1781 | resize_image=ResizeImage(image,width,height,image->filter,exception); |
|---|
| 1782 | if (resize_image == (Image *) NULL) |
|---|
| 1783 | return((Image *) NULL); |
|---|
| 1784 | rescale_image=LiquidRescaleImage(resize_image,columns,rows,delta_x, |
|---|
| 1785 | rigidity,exception); |
|---|
| 1786 | resize_image=DestroyImage(resize_image); |
|---|
| 1787 | return(rescale_image); |
|---|
| 1788 | } |
|---|
| 1789 | pixels=(gfloat *) AcquireQuantumMemory(image->columns,image->rows* |
|---|
| 1790 | GetPixelChannels(image)*sizeof(*pixels)); |
|---|
| 1791 | if (pixels == (gfloat *) NULL) |
|---|
| 1792 | return((Image *) NULL); |
|---|
| 1793 | status=MagickTrue; |
|---|
| 1794 | q=pixels; |
|---|
| 1795 | image_view=AcquireVirtualCacheView(image,exception); |
|---|
| 1796 | for (y=0; y < (ssize_t) image->rows; y++) |
|---|
| 1797 | { |
|---|
| 1798 | register const Quantum |
|---|
| 1799 | *restrict p; |
|---|
| 1800 | |
|---|
| 1801 | register ssize_t |
|---|
| 1802 | x; |
|---|
| 1803 | |
|---|
| 1804 | if( IfMagickFalse(status) ) |
|---|
| 1805 | continue; |
|---|
| 1806 | p=GetCacheViewVirtualPixels(image_view,0,y,image->columns,1,exception); |
|---|
| 1807 | if (p == (const Quantum *) NULL) |
|---|
| 1808 | { |
|---|
| 1809 | status=MagickFalse; |
|---|
| 1810 | continue; |
|---|
| 1811 | } |
|---|
| 1812 | for (x=0; x < (ssize_t) image->columns; x++) |
|---|
| 1813 | { |
|---|
| 1814 | register ssize_t |
|---|
| 1815 | i; |
|---|
| 1816 | |
|---|
| 1817 | for (i=0; i < (ssize_t) GetPixelChannels(image); i++) |
|---|
| 1818 | *q++=QuantumScale*p[i]; |
|---|
| 1819 | p+=GetPixelChannels(image); |
|---|
| 1820 | } |
|---|
| 1821 | } |
|---|
| 1822 | image_view=DestroyCacheView(image_view); |
|---|
| 1823 | carver=lqr_carver_new_ext(pixels,image->columns,image->rows, |
|---|
| 1824 | GetPixelChannels(image),LQR_COLDEPTH_32F); |
|---|
| 1825 | if (carver == (LqrCarver *) NULL) |
|---|
| 1826 | { |
|---|
| 1827 | pixels=(gfloat *) RelinquishMagickMemory(pixels); |
|---|
| 1828 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
|---|
| 1829 | } |
|---|
| 1830 | lqr_status=lqr_carver_init(carver,(int) delta_x,rigidity); |
|---|
| 1831 | lqr_status=lqr_carver_resize(carver,columns,rows); |
|---|
| 1832 | (void) lqr_status; |
|---|
| 1833 | rescale_image=CloneImage(image,lqr_carver_get_width(carver), |
|---|
| 1834 | lqr_carver_get_height(carver),MagickTrue,exception); |
|---|
| 1835 | if (rescale_image == (Image *) NULL) |
|---|
| 1836 | { |
|---|
| 1837 | pixels=(gfloat *) RelinquishMagickMemory(pixels); |
|---|
| 1838 | return((Image *) NULL); |
|---|
| 1839 | } |
|---|
| 1840 | if( IfMagickFalse(SetImageStorageClass(rescale_image,DirectClass,exception)) ) |
|---|
| 1841 | { |
|---|
| 1842 | pixels=(gfloat *) RelinquishMagickMemory(pixels); |
|---|
| 1843 | rescale_image=DestroyImage(rescale_image); |
|---|
| 1844 | return((Image *) NULL); |
|---|
| 1845 | } |
|---|
| 1846 | rescale_view=AcquireAuthenticCacheView(rescale_image,exception); |
|---|
| 1847 | (void) lqr_carver_scan_reset(carver); |
|---|
| 1848 | while (lqr_carver_scan_ext(carver,&x_offset,&y_offset,(void **) &packet) != 0) |
|---|
| 1849 | { |
|---|
| 1850 | register Quantum |
|---|
| 1851 | *restrict q; |
|---|
| 1852 | |
|---|
| 1853 | register ssize_t |
|---|
| 1854 | i; |
|---|
| 1855 | |
|---|
| 1856 | q=QueueCacheViewAuthenticPixels(rescale_view,x_offset,y_offset,1,1, |
|---|
| 1857 | exception); |
|---|
| 1858 | if (q == (Quantum *) NULL) |
|---|
| 1859 | break; |
|---|
| 1860 | for (i=0; i < (ssize_t) GetPixelChannels(image); i++) |
|---|
| 1861 | { |
|---|
| 1862 | PixelChannel |
|---|
| 1863 | channel; |
|---|
| 1864 | |
|---|
| 1865 | PixelTrait |
|---|
| 1866 | rescale_traits, |
|---|
| 1867 | traits; |
|---|
| 1868 | |
|---|
| 1869 | channel=GetPixelChannelMapChannel(image,i); |
|---|
| 1870 | traits=GetPixelChannelMapTraits(image,channel); |
|---|
| 1871 | rescale_traits=GetPixelChannelMapTraits(rescale_image,channel); |
|---|
| 1872 | if ((traits == UndefinedPixelTrait) || |
|---|
| 1873 | (rescale_traits == UndefinedPixelTrait)) |
|---|
| 1874 | continue; |
|---|
| 1875 | SetPixelChannel(rescale_image,channel,ClampToQuantum(QuantumRange* |
|---|
| 1876 | packet[i]),q); |
|---|
| 1877 | } |
|---|
| 1878 | if( IfMagickFalse(SyncCacheViewAuthenticPixels(rescale_view,exception)) ) |
|---|
| 1879 | break; |
|---|
| 1880 | } |
|---|
| 1881 | rescale_view=DestroyCacheView(rescale_view); |
|---|
| 1882 | lqr_carver_destroy(carver); |
|---|
| 1883 | return(rescale_image); |
|---|
| 1884 | } |
|---|
| 1885 | #else |
|---|
| 1886 | MagickExport Image *LiquidRescaleImage(const Image *image, |
|---|
| 1887 | const size_t magick_unused(columns),const size_t magick_unused(rows), |
|---|
| 1888 | const double magick_unused(delta_x),const double magick_unused(rigidity), |
|---|
| 1889 | ExceptionInfo *exception) |
|---|
| 1890 | { |
|---|
| 1891 | assert(image != (const Image *) NULL); |
|---|
| 1892 | assert(image->signature == MagickSignature); |
|---|
| 1893 | if( IfMagickTrue(image->debug) ) |
|---|
| 1894 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
|---|
| 1895 | assert(exception != (ExceptionInfo *) NULL); |
|---|
| 1896 | assert(exception->signature == MagickSignature); |
|---|
| 1897 | (void) ThrowMagickException(exception,GetMagickModule(),MissingDelegateError, |
|---|
| 1898 | "DelegateLibrarySupportNotBuiltIn","'%s' (LQR)",image->filename); |
|---|
| 1899 | return((Image *) NULL); |
|---|
| 1900 | } |
|---|
| 1901 | #endif |
|---|
| 1902 | |
|---|
| 1903 | /* |
|---|
| 1904 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1905 | % % |
|---|
| 1906 | % % |
|---|
| 1907 | % % |
|---|
| 1908 | % M a g n i f y I m a g e % |
|---|
| 1909 | % % |
|---|
| 1910 | % % |
|---|
| 1911 | % % |
|---|
| 1912 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1913 | % |
|---|
| 1914 | % MagnifyImage() is a convenience method that scales an image proportionally |
|---|
| 1915 | % to twice its size. |
|---|
| 1916 | % |
|---|
| 1917 | % The format of the MagnifyImage method is: |
|---|
| 1918 | % |
|---|
| 1919 | % Image *MagnifyImage(const Image *image,ExceptionInfo *exception) |
|---|
| 1920 | % |
|---|
| 1921 | % A description of each parameter follows: |
|---|
| 1922 | % |
|---|
| 1923 | % o image: the image. |
|---|
| 1924 | % |
|---|
| 1925 | % o exception: return any errors or warnings in this structure. |
|---|
| 1926 | % |
|---|
| 1927 | */ |
|---|
| 1928 | MagickExport Image *MagnifyImage(const Image *image,ExceptionInfo *exception) |
|---|
| 1929 | { |
|---|
| 1930 | Image |
|---|
| 1931 | *magnify_image; |
|---|
| 1932 | |
|---|
| 1933 | assert(image != (Image *) NULL); |
|---|
| 1934 | assert(image->signature == MagickSignature); |
|---|
| 1935 | if( IfMagickTrue(image->debug) ) |
|---|
| 1936 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
|---|
| 1937 | assert(exception != (ExceptionInfo *) NULL); |
|---|
| 1938 | assert(exception->signature == MagickSignature); |
|---|
| 1939 | magnify_image=ResizeImage(image,2*image->columns,2*image->rows,CubicFilter, |
|---|
| 1940 | exception); |
|---|
| 1941 | return(magnify_image); |
|---|
| 1942 | } |
|---|
| 1943 | |
|---|
| 1944 | /* |
|---|
| 1945 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1946 | % % |
|---|
| 1947 | % % |
|---|
| 1948 | % % |
|---|
| 1949 | % M i n i f y I m a g e % |
|---|
| 1950 | % % |
|---|
| 1951 | % % |
|---|
| 1952 | % % |
|---|
| 1953 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1954 | % |
|---|
| 1955 | % MinifyImage() is a convenience method that scales an image proportionally to |
|---|
| 1956 | % half its size. |
|---|
| 1957 | % |
|---|
| 1958 | % The format of the MinifyImage method is: |
|---|
| 1959 | % |
|---|
| 1960 | % Image *MinifyImage(const Image *image,ExceptionInfo *exception) |
|---|
| 1961 | % |
|---|
| 1962 | % A description of each parameter follows: |
|---|
| 1963 | % |
|---|
| 1964 | % o image: the image. |
|---|
| 1965 | % |
|---|
| 1966 | % o exception: return any errors or warnings in this structure. |
|---|
| 1967 | % |
|---|
| 1968 | */ |
|---|
| 1969 | MagickExport Image *MinifyImage(const Image *image,ExceptionInfo *exception) |
|---|
| 1970 | { |
|---|
| 1971 | Image |
|---|
| 1972 | *minify_image; |
|---|
| 1973 | |
|---|
| 1974 | assert(image != (Image *) NULL); |
|---|
| 1975 | assert(image->signature == MagickSignature); |
|---|
| 1976 | if( IfMagickTrue(image->debug) ) |
|---|
| 1977 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
|---|
| 1978 | assert(exception != (ExceptionInfo *) NULL); |
|---|
| 1979 | assert(exception->signature == MagickSignature); |
|---|
| 1980 | minify_image=ResizeImage(image,image->columns/2,image->rows/2,CubicFilter, |
|---|
| 1981 | exception); |
|---|
| 1982 | return(minify_image); |
|---|
| 1983 | } |
|---|
| 1984 | |
|---|
| 1985 | /* |
|---|
| 1986 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1987 | % % |
|---|
| 1988 | % % |
|---|
| 1989 | % % |
|---|
| 1990 | % R e s a m p l e I m a g e % |
|---|
| 1991 | % % |
|---|
| 1992 | % % |
|---|
| 1993 | % % |
|---|
| 1994 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 1995 | % |
|---|
| 1996 | % ResampleImage() resize image in terms of its pixel size, so that when |
|---|
| 1997 | % displayed at the given resolution it will be the same size in terms of |
|---|
| 1998 | % real world units as the original image at the original resolution. |
|---|
| 1999 | % |
|---|
| 2000 | % The format of the ResampleImage method is: |
|---|
| 2001 | % |
|---|
| 2002 | % Image *ResampleImage(Image *image,const double x_resolution, |
|---|
| 2003 | % const double y_resolution,const FilterTypes filter, |
|---|
| 2004 | % ExceptionInfo *exception) |
|---|
| 2005 | % |
|---|
| 2006 | % A description of each parameter follows: |
|---|
| 2007 | % |
|---|
| 2008 | % o image: the image to be resized to fit the given resolution. |
|---|
| 2009 | % |
|---|
| 2010 | % o x_resolution: the new image x resolution. |
|---|
| 2011 | % |
|---|
| 2012 | % o y_resolution: the new image y resolution. |
|---|
| 2013 | % |
|---|
| 2014 | % o filter: Image filter to use. |
|---|
| 2015 | % |
|---|
| 2016 | % o exception: return any errors or warnings in this structure. |
|---|
| 2017 | % |
|---|
| 2018 | */ |
|---|
| 2019 | MagickExport Image *ResampleImage(const Image *image,const double x_resolution, |
|---|
| 2020 | const double y_resolution,const FilterTypes filter,ExceptionInfo *exception) |
|---|
| 2021 | { |
|---|
| 2022 | #define ResampleImageTag "Resample/Image" |
|---|
| 2023 | |
|---|
| 2024 | Image |
|---|
| 2025 | *resample_image; |
|---|
| 2026 | |
|---|
| 2027 | size_t |
|---|
| 2028 | height, |
|---|
| 2029 | width; |
|---|
| 2030 | |
|---|
| 2031 | /* |
|---|
| 2032 | Initialize sampled image attributes. |
|---|
| 2033 | */ |
|---|
| 2034 | assert(image != (const Image *) NULL); |
|---|
| 2035 | assert(image->signature == MagickSignature); |
|---|
| 2036 | if( IfMagickTrue(image->debug) ) |
|---|
| 2037 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
|---|
| 2038 | assert(exception != (ExceptionInfo *) NULL); |
|---|
| 2039 | assert(exception->signature == MagickSignature); |
|---|
| 2040 | width=(size_t) (x_resolution*image->columns/(image->resolution.x == 0.0 ? |
|---|
| 2041 | 72.0 : image->resolution.x)+0.5); |
|---|
| 2042 | height=(size_t) (y_resolution*image->rows/(image->resolution.y == 0.0 ? |
|---|
| 2043 | 72.0 : image->resolution.y)+0.5); |
|---|
| 2044 | resample_image=ResizeImage(image,width,height,filter,exception); |
|---|
| 2045 | if (resample_image != (Image *) NULL) |
|---|
| 2046 | { |
|---|
| 2047 | resample_image->resolution.x=x_resolution; |
|---|
| 2048 | resample_image->resolution.y=y_resolution; |
|---|
| 2049 | } |
|---|
| 2050 | return(resample_image); |
|---|
| 2051 | } |
|---|
| 2052 | |
|---|
| 2053 | /* |
|---|
| 2054 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 2055 | % % |
|---|
| 2056 | % % |
|---|
| 2057 | % % |
|---|
| 2058 | % R e s i z e I m a g e % |
|---|
| 2059 | % % |
|---|
| 2060 | % % |
|---|
| 2061 | % % |
|---|
| 2062 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 2063 | % |
|---|
| 2064 | % ResizeImage() scales an image to the desired dimensions, using the given |
|---|
| 2065 | % filter (see AcquireFilterInfo()). |
|---|
| 2066 | % |
|---|
| 2067 | % If an undefined filter is given the filter defaults to Mitchell for a |
|---|
| 2068 | % colormapped image, a image with a matte channel, or if the image is |
|---|
| 2069 | % enlarged. Otherwise the filter defaults to a Lanczos. |
|---|
| 2070 | % |
|---|
| 2071 | % ResizeImage() was inspired by Paul Heckbert's "zoom" program. |
|---|
| 2072 | % |
|---|
| 2073 | % The format of the ResizeImage method is: |
|---|
| 2074 | % |
|---|
| 2075 | % Image *ResizeImage(Image *image,const size_t columns, |
|---|
| 2076 | % const size_t rows,const FilterTypes filter,const double blur, |
|---|
| 2077 | % ExceptionInfo *exception) |
|---|
| 2078 | % |
|---|
| 2079 | % A description of each parameter follows: |
|---|
| 2080 | % |
|---|
| 2081 | % o image: the image. |
|---|
| 2082 | % |
|---|
| 2083 | % o columns: the number of columns in the scaled image. |
|---|
| 2084 | % |
|---|
| 2085 | % o rows: the number of rows in the scaled image. |
|---|
| 2086 | % |
|---|
| 2087 | % o filter: Image filter to use. |
|---|
| 2088 | % |
|---|
| 2089 | % o blur: the blur factor where > 1 is blurry, < 1 is sharp. Typically set |
|---|
| 2090 | % this to 1.0. |
|---|
| 2091 | % |
|---|
| 2092 | % o exception: return any errors or warnings in this structure. |
|---|
| 2093 | % |
|---|
| 2094 | */ |
|---|
| 2095 | |
|---|
| 2096 | typedef struct _ContributionInfo |
|---|
| 2097 | { |
|---|
| 2098 | MagickRealType |
|---|
| 2099 | weight; |
|---|
| 2100 | |
|---|
| 2101 | ssize_t |
|---|
| 2102 | pixel; |
|---|
| 2103 | } ContributionInfo; |
|---|
| 2104 | |
|---|
| 2105 | static ContributionInfo **DestroyContributionThreadSet( |
|---|
| 2106 | ContributionInfo **contribution) |
|---|
| 2107 | { |
|---|
| 2108 | register ssize_t |
|---|
| 2109 | i; |
|---|
| 2110 | |
|---|
| 2111 | assert(contribution != (ContributionInfo **) NULL); |
|---|
| 2112 | for (i=0; i < (ssize_t) GetMagickResourceLimit(ThreadResource); i++) |
|---|
| 2113 | if (contribution[i] != (ContributionInfo *) NULL) |
|---|
| 2114 | contribution[i]=(ContributionInfo *) RelinquishAlignedMemory( |
|---|
| 2115 | contribution[i]); |
|---|
| 2116 | contribution=(ContributionInfo **) RelinquishMagickMemory(contribution); |
|---|
| 2117 | return(contribution); |
|---|
| 2118 | } |
|---|
| 2119 | |
|---|
| 2120 | static ContributionInfo **AcquireContributionThreadSet(const size_t count) |
|---|
| 2121 | { |
|---|
| 2122 | register ssize_t |
|---|
| 2123 | i; |
|---|
| 2124 | |
|---|
| 2125 | ContributionInfo |
|---|
| 2126 | **contribution; |
|---|
| 2127 | |
|---|
| 2128 | size_t |
|---|
| 2129 | number_threads; |
|---|
| 2130 | |
|---|
| 2131 | number_threads=(size_t) GetMagickResourceLimit(ThreadResource); |
|---|
| 2132 | contribution=(ContributionInfo **) AcquireQuantumMemory(number_threads, |
|---|
| 2133 | sizeof(*contribution)); |
|---|
| 2134 | if (contribution == (ContributionInfo **) NULL) |
|---|
| 2135 | return((ContributionInfo **) NULL); |
|---|
| 2136 | (void) ResetMagickMemory(contribution,0,number_threads*sizeof(*contribution)); |
|---|
| 2137 | for (i=0; i < (ssize_t) number_threads; i++) |
|---|
| 2138 | { |
|---|
| 2139 | contribution[i]=(ContributionInfo *) AcquireAlignedMemory(count, |
|---|
| 2140 | sizeof(**contribution)); |
|---|
| 2141 | if (contribution[i] == (ContributionInfo *) NULL) |
|---|
| 2142 | return(DestroyContributionThreadSet(contribution)); |
|---|
| 2143 | } |
|---|
| 2144 | return(contribution); |
|---|
| 2145 | } |
|---|
| 2146 | |
|---|
| 2147 | static inline double MagickMax(const double x,const double y) |
|---|
| 2148 | { |
|---|
| 2149 | if (x > y) |
|---|
| 2150 | return(x); |
|---|
| 2151 | return(y); |
|---|
| 2152 | } |
|---|
| 2153 | |
|---|
| 2154 | static inline double MagickMin(const double x,const double y) |
|---|
| 2155 | { |
|---|
| 2156 | if (x < y) |
|---|
| 2157 | return(x); |
|---|
| 2158 | return(y); |
|---|
| 2159 | } |
|---|
| 2160 | |
|---|
| 2161 | static MagickBooleanType HorizontalFilter(const ResizeFilter *resize_filter, |
|---|
| 2162 | const Image *image,Image *resize_image,const MagickRealType x_factor, |
|---|
| 2163 | const MagickSizeType span,MagickOffsetType *offset,ExceptionInfo *exception) |
|---|
| 2164 | { |
|---|
| 2165 | #define ResizeImageTag "Resize/Image" |
|---|
| 2166 | |
|---|
| 2167 | CacheView |
|---|
| 2168 | *image_view, |
|---|
| 2169 | *resize_view; |
|---|
| 2170 | |
|---|
| 2171 | ClassType |
|---|
| 2172 | storage_class; |
|---|
| 2173 | |
|---|
| 2174 | ContributionInfo |
|---|
| 2175 | **restrict contributions; |
|---|
| 2176 | |
|---|
| 2177 | MagickBooleanType |
|---|
| 2178 | status; |
|---|
| 2179 | |
|---|
| 2180 | MagickRealType |
|---|
| 2181 | scale, |
|---|
| 2182 | support; |
|---|
| 2183 | |
|---|
| 2184 | ssize_t |
|---|
| 2185 | x; |
|---|
| 2186 | |
|---|
| 2187 | /* |
|---|
| 2188 | Apply filter to resize horizontally from image to resize image. |
|---|
| 2189 | */ |
|---|
| 2190 | scale=MagickMax(1.0/x_factor+MagickEpsilon,1.0); |
|---|
| 2191 | support=scale*GetResizeFilterSupport(resize_filter); |
|---|
| 2192 | storage_class=support > 0.5 ? DirectClass : image->storage_class; |
|---|
| 2193 | if( IfMagickFalse(SetImageStorageClass(resize_image,storage_class,exception)) ) |
|---|
| 2194 | return(MagickFalse); |
|---|
| 2195 | if (support < 0.5) |
|---|
| 2196 | { |
|---|
| 2197 | /* |
|---|
| 2198 | Support too small even for nearest neighbour: Reduce to point sampling. |
|---|
| 2199 | */ |
|---|
| 2200 | support=(MagickRealType) 0.5; |
|---|
| 2201 | scale=1.0; |
|---|
| 2202 | } |
|---|
| 2203 | contributions=AcquireContributionThreadSet((size_t) (2.0*support+3.0)); |
|---|
| 2204 | if (contributions == (ContributionInfo **) NULL) |
|---|
| 2205 | { |
|---|
| 2206 | (void) ThrowMagickException(exception,GetMagickModule(), |
|---|
| 2207 | ResourceLimitError,"MemoryAllocationFailed","'%s'",image->filename); |
|---|
| 2208 | return(MagickFalse); |
|---|
| 2209 | } |
|---|
| 2210 | status=MagickTrue; |
|---|
| 2211 | scale=1.0/scale; |
|---|
| 2212 | image_view=AcquireVirtualCacheView(image,exception); |
|---|
| 2213 | resize_view=AcquireAuthenticCacheView(resize_image,exception); |
|---|
| 2214 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
|---|
| 2215 | #pragma omp parallel for schedule(static,4) shared(status) \ |
|---|
| 2216 | dynamic_number_threads(image->columns,image->rows,1) |
|---|
| 2217 | #endif |
|---|
| 2218 | for (x=0; x < (ssize_t) resize_image->columns; x++) |
|---|
| 2219 | { |
|---|
| 2220 | MagickRealType |
|---|
| 2221 | bisect, |
|---|
| 2222 | density; |
|---|
| 2223 | |
|---|
| 2224 | register const Quantum |
|---|
| 2225 | *restrict p; |
|---|
| 2226 | |
|---|
| 2227 | register ContributionInfo |
|---|
| 2228 | *restrict contribution; |
|---|
| 2229 | |
|---|
| 2230 | register Quantum |
|---|
| 2231 | *restrict q; |
|---|
| 2232 | |
|---|
| 2233 | register ssize_t |
|---|
| 2234 | y; |
|---|
| 2235 | |
|---|
| 2236 | ssize_t |
|---|
| 2237 | n, |
|---|
| 2238 | start, |
|---|
| 2239 | stop; |
|---|
| 2240 | |
|---|
| 2241 | if( IfMagickFalse(status) ) |
|---|
| 2242 | continue; |
|---|
| 2243 | bisect=(MagickRealType) (x+0.5)/x_factor+MagickEpsilon; |
|---|
| 2244 | start=(ssize_t) MagickMax(bisect-support+0.5,0.0); |
|---|
| 2245 | stop=(ssize_t) MagickMin(bisect+support+0.5,(double) image->columns); |
|---|
| 2246 | density=0.0; |
|---|
| 2247 | contribution=contributions[GetOpenMPThreadId()]; |
|---|
| 2248 | for (n=0; n < (stop-start); n++) |
|---|
| 2249 | { |
|---|
| 2250 | contribution[n].pixel=start+n; |
|---|
| 2251 | contribution[n].weight=GetResizeFilterWeight(resize_filter,scale* |
|---|
| 2252 | ((MagickRealType) (start+n)-bisect+0.5)); |
|---|
| 2253 | density+=contribution[n].weight; |
|---|
| 2254 | } |
|---|
| 2255 | if ((density != 0.0) && (density != 1.0)) |
|---|
| 2256 | { |
|---|
| 2257 | register ssize_t |
|---|
| 2258 | i; |
|---|
| 2259 | |
|---|
| 2260 | /* |
|---|
| 2261 | Normalize. |
|---|
| 2262 | */ |
|---|
| 2263 | density=1.0/density; |
|---|
| 2264 | for (i=0; i < n; i++) |
|---|
| 2265 | contribution[i].weight*=density; |
|---|
| 2266 | } |
|---|
| 2267 | p=GetCacheViewVirtualPixels(image_view,contribution[0].pixel,0,(size_t) |
|---|
| 2268 | (contribution[n-1].pixel-contribution[0].pixel+1),image->rows,exception); |
|---|
| 2269 | q=QueueCacheViewAuthenticPixels(resize_view,x,0,1,resize_image->rows, |
|---|
| 2270 | exception); |
|---|
| 2271 | if ((p == (const Quantum *) NULL) || (q == (Quantum *) NULL)) |
|---|
| 2272 | { |
|---|
| 2273 | status=MagickFalse; |
|---|
| 2274 | continue; |
|---|
| 2275 | } |
|---|
| 2276 | for (y=0; y < (ssize_t) resize_image->rows; y++) |
|---|
| 2277 | { |
|---|
| 2278 | register ssize_t |
|---|
| 2279 | i; |
|---|
| 2280 | |
|---|
| 2281 | if (GetPixelMask(resize_image,q) != 0) |
|---|
| 2282 | { |
|---|
| 2283 | q+=GetPixelChannels(resize_image); |
|---|
| 2284 | continue; |
|---|
| 2285 | } |
|---|
| 2286 | for (i=0; i < (ssize_t) GetPixelChannels(resize_image); i++) |
|---|
| 2287 | { |
|---|
| 2288 | MagickRealType |
|---|
| 2289 | alpha, |
|---|
| 2290 | gamma, |
|---|
| 2291 | pixel; |
|---|
| 2292 | |
|---|
| 2293 | PixelChannel |
|---|
| 2294 | channel; |
|---|
| 2295 | |
|---|
| 2296 | PixelTrait |
|---|
| 2297 | resize_traits, |
|---|
| 2298 | traits; |
|---|
| 2299 | |
|---|
| 2300 | register ssize_t |
|---|
| 2301 | j; |
|---|
| 2302 | |
|---|
| 2303 | ssize_t |
|---|
| 2304 | k; |
|---|
| 2305 | |
|---|
| 2306 | channel=GetPixelChannelMapChannel(image,i); |
|---|
| 2307 | traits=GetPixelChannelMapTraits(image,channel); |
|---|
| 2308 | resize_traits=GetPixelChannelMapTraits(resize_image,channel); |
|---|
| 2309 | if ((traits == UndefinedPixelTrait) || |
|---|
| 2310 | (resize_traits == UndefinedPixelTrait)) |
|---|
| 2311 | continue; |
|---|
| 2312 | if ((resize_traits & CopyPixelTrait) != 0) |
|---|
| 2313 | { |
|---|
| 2314 | j=(ssize_t) (MagickMin(MagickMax(bisect,(double) start),(double) |
|---|
| 2315 | stop-1.0)+0.5); |
|---|
| 2316 | k=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
|---|
| 2317 | (contribution[j-start].pixel-contribution[0].pixel); |
|---|
| 2318 | SetPixelChannel(resize_image,channel,p[k*GetPixelChannels(image)+i], |
|---|
| 2319 | q); |
|---|
| 2320 | continue; |
|---|
| 2321 | } |
|---|
| 2322 | pixel=0.0; |
|---|
| 2323 | if ((resize_traits & BlendPixelTrait) == 0) |
|---|
| 2324 | { |
|---|
| 2325 | /* |
|---|
| 2326 | No alpha blending. |
|---|
| 2327 | */ |
|---|
| 2328 | for (j=0; j < n; j++) |
|---|
| 2329 | { |
|---|
| 2330 | k=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
|---|
| 2331 | (contribution[j].pixel-contribution[0].pixel); |
|---|
| 2332 | alpha=contribution[j].weight; |
|---|
| 2333 | pixel+=alpha*p[k*GetPixelChannels(image)+i]; |
|---|
| 2334 | } |
|---|
| 2335 | SetPixelChannel(resize_image,channel,ClampToQuantum(pixel),q); |
|---|
| 2336 | continue; |
|---|
| 2337 | } |
|---|
| 2338 | /* |
|---|
| 2339 | Alpha blending. |
|---|
| 2340 | */ |
|---|
| 2341 | gamma=0.0; |
|---|
| 2342 | for (j=0; j < n; j++) |
|---|
| 2343 | { |
|---|
| 2344 | k=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
|---|
| 2345 | (contribution[j].pixel-contribution[0].pixel); |
|---|
| 2346 | alpha=contribution[j].weight*QuantumScale* |
|---|
| 2347 | GetPixelAlpha(image,p+k*GetPixelChannels(image)); |
|---|
| 2348 | pixel+=alpha*p[k*GetPixelChannels(image)+i]; |
|---|
| 2349 | gamma+=alpha; |
|---|
| 2350 | } |
|---|
| 2351 | gamma=1.0/(fabs((double) gamma) <= MagickEpsilon ? 1.0 : gamma); |
|---|
| 2352 | SetPixelChannel(resize_image,channel,ClampToQuantum(gamma*pixel),q); |
|---|
| 2353 | } |
|---|
| 2354 | q+=GetPixelChannels(resize_image); |
|---|
| 2355 | } |
|---|
| 2356 | if( IfMagickFalse(SyncCacheViewAuthenticPixels(resize_view,exception)) ) |
|---|
| 2357 | status=MagickFalse; |
|---|
| 2358 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
|---|
| 2359 | { |
|---|
| 2360 | MagickBooleanType |
|---|
| 2361 | proceed; |
|---|
| 2362 | |
|---|
| 2363 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
|---|
| 2364 | #pragma omp critical (MagickCore_HorizontalFilter) |
|---|
| 2365 | #endif |
|---|
| 2366 | proceed=SetImageProgress(image,ResizeImageTag,(*offset)++,span); |
|---|
| 2367 | if( IfMagickFalse(proceed) ) |
|---|
| 2368 | status=MagickFalse; |
|---|
| 2369 | } |
|---|
| 2370 | } |
|---|
| 2371 | resize_view=DestroyCacheView(resize_view); |
|---|
| 2372 | image_view=DestroyCacheView(image_view); |
|---|
| 2373 | contributions=DestroyContributionThreadSet(contributions); |
|---|
| 2374 | return(status); |
|---|
| 2375 | } |
|---|
| 2376 | |
|---|
| 2377 | static MagickBooleanType VerticalFilter(const ResizeFilter *resize_filter, |
|---|
| 2378 | const Image *image,Image *resize_image,const MagickRealType y_factor, |
|---|
| 2379 | const MagickSizeType span,MagickOffsetType *offset,ExceptionInfo *exception) |
|---|
| 2380 | { |
|---|
| 2381 | CacheView |
|---|
| 2382 | *image_view, |
|---|
| 2383 | *resize_view; |
|---|
| 2384 | |
|---|
| 2385 | ClassType |
|---|
| 2386 | storage_class; |
|---|
| 2387 | |
|---|
| 2388 | ContributionInfo |
|---|
| 2389 | **restrict contributions; |
|---|
| 2390 | |
|---|
| 2391 | MagickBooleanType |
|---|
| 2392 | status; |
|---|
| 2393 | |
|---|
| 2394 | PixelInfo |
|---|
| 2395 | zero; |
|---|
| 2396 | |
|---|
| 2397 | MagickRealType |
|---|
| 2398 | scale, |
|---|
| 2399 | support; |
|---|
| 2400 | |
|---|
| 2401 | ssize_t |
|---|
| 2402 | y; |
|---|
| 2403 | |
|---|
| 2404 | /* |
|---|
| 2405 | Apply filter to resize vertically from image to resize image. |
|---|
| 2406 | */ |
|---|
| 2407 | scale=MagickMax(1.0/y_factor+MagickEpsilon,1.0); |
|---|
| 2408 | support=scale*GetResizeFilterSupport(resize_filter); |
|---|
| 2409 | storage_class=support > 0.5 ? DirectClass : image->storage_class; |
|---|
| 2410 | if( IfMagickFalse(SetImageStorageClass(resize_image,storage_class,exception)) ) |
|---|
| 2411 | return(MagickFalse); |
|---|
| 2412 | if (support < 0.5) |
|---|
| 2413 | { |
|---|
| 2414 | /* |
|---|
| 2415 | Support too small even for nearest neighbour: Reduce to point sampling. |
|---|
| 2416 | */ |
|---|
| 2417 | support=(MagickRealType) 0.5; |
|---|
| 2418 | scale=1.0; |
|---|
| 2419 | } |
|---|
| 2420 | contributions=AcquireContributionThreadSet((size_t) (2.0*support+3.0)); |
|---|
| 2421 | if (contributions == (ContributionInfo **) NULL) |
|---|
| 2422 | { |
|---|
| 2423 | (void) ThrowMagickException(exception,GetMagickModule(), |
|---|
| 2424 | ResourceLimitError,"MemoryAllocationFailed","'%s'",image->filename); |
|---|
| 2425 | return(MagickFalse); |
|---|
| 2426 | } |
|---|
| 2427 | status=MagickTrue; |
|---|
| 2428 | scale=1.0/scale; |
|---|
| 2429 | (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
|---|
| 2430 | image_view=AcquireVirtualCacheView(image,exception); |
|---|
| 2431 | resize_view=AcquireAuthenticCacheView(resize_image,exception); |
|---|
| 2432 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
|---|
| 2433 | #pragma omp parallel for schedule(static,4) shared(status) \ |
|---|
| 2434 | dynamic_number_threads(image->columns,image->rows,1) |
|---|
| 2435 | #endif |
|---|
| 2436 | for (y=0; y < (ssize_t) resize_image->rows; y++) |
|---|
| 2437 | { |
|---|
| 2438 | MagickRealType |
|---|
| 2439 | bisect, |
|---|
| 2440 | density; |
|---|
| 2441 | |
|---|
| 2442 | register const Quantum |
|---|
| 2443 | *restrict p; |
|---|
| 2444 | |
|---|
| 2445 | register ContributionInfo |
|---|
| 2446 | *restrict contribution; |
|---|
| 2447 | |
|---|
| 2448 | register Quantum |
|---|
| 2449 | *restrict q; |
|---|
| 2450 | |
|---|
| 2451 | register ssize_t |
|---|
| 2452 | x; |
|---|
| 2453 | |
|---|
| 2454 | ssize_t |
|---|
| 2455 | n, |
|---|
| 2456 | start, |
|---|
| 2457 | stop; |
|---|
| 2458 | |
|---|
| 2459 | if( IfMagickFalse(status) ) |
|---|
| 2460 | continue; |
|---|
| 2461 | bisect=(MagickRealType) (y+0.5)/y_factor+MagickEpsilon; |
|---|
| 2462 | start=(ssize_t) MagickMax(bisect-support+0.5,0.0); |
|---|
| 2463 | stop=(ssize_t) MagickMin(bisect+support+0.5,(double) image->rows); |
|---|
| 2464 | density=0.0; |
|---|
| 2465 | contribution=contributions[GetOpenMPThreadId()]; |
|---|
| 2466 | for (n=0; n < (stop-start); n++) |
|---|
| 2467 | { |
|---|
| 2468 | contribution[n].pixel=start+n; |
|---|
| 2469 | contribution[n].weight=GetResizeFilterWeight(resize_filter,scale* |
|---|
| 2470 | ((MagickRealType) (start+n)-bisect+0.5)); |
|---|
| 2471 | density+=contribution[n].weight; |
|---|
| 2472 | } |
|---|
| 2473 | if ((density != 0.0) && (density != 1.0)) |
|---|
| 2474 | { |
|---|
| 2475 | register ssize_t |
|---|
| 2476 | i; |
|---|
| 2477 | |
|---|
| 2478 | /* |
|---|
| 2479 | Normalize. |
|---|
| 2480 | */ |
|---|
| 2481 | density=1.0/density; |
|---|
| 2482 | for (i=0; i < n; i++) |
|---|
| 2483 | contribution[i].weight*=density; |
|---|
| 2484 | } |
|---|
| 2485 | p=GetCacheViewVirtualPixels(image_view,0,contribution[0].pixel, |
|---|
| 2486 | image->columns,(size_t) (contribution[n-1].pixel-contribution[0].pixel+1), |
|---|
| 2487 | exception); |
|---|
| 2488 | q=QueueCacheViewAuthenticPixels(resize_view,0,y,resize_image->columns,1, |
|---|
| 2489 | exception); |
|---|
| 2490 | if ((p == (const Quantum *) NULL) || (q == (Quantum *) NULL)) |
|---|
| 2491 | { |
|---|
| 2492 | status=MagickFalse; |
|---|
| 2493 | continue; |
|---|
| 2494 | } |
|---|
| 2495 | for (x=0; x < (ssize_t) resize_image->columns; x++) |
|---|
| 2496 | { |
|---|
| 2497 | register ssize_t |
|---|
| 2498 | i; |
|---|
| 2499 | |
|---|
| 2500 | if (GetPixelMask(resize_image,q) != 0) |
|---|
| 2501 | { |
|---|
| 2502 | q+=GetPixelChannels(resize_image); |
|---|
| 2503 | continue; |
|---|
| 2504 | } |
|---|
| 2505 | for (i=0; i < (ssize_t) GetPixelChannels(resize_image); i++) |
|---|
| 2506 | { |
|---|
| 2507 | MagickRealType |
|---|
| 2508 | alpha, |
|---|
| 2509 | gamma, |
|---|
| 2510 | pixel; |
|---|
| 2511 | |
|---|
| 2512 | PixelChannel |
|---|
| 2513 | channel; |
|---|
| 2514 | |
|---|
| 2515 | PixelTrait |
|---|
| 2516 | resize_traits, |
|---|
| 2517 | traits; |
|---|
| 2518 | |
|---|
| 2519 | register ssize_t |
|---|
| 2520 | j; |
|---|
| 2521 | |
|---|
| 2522 | ssize_t |
|---|
| 2523 | k; |
|---|
| 2524 | |
|---|
| 2525 | channel=GetPixelChannelMapChannel(image,i); |
|---|
| 2526 | traits=GetPixelChannelMapTraits(image,channel); |
|---|
| 2527 | resize_traits=GetPixelChannelMapTraits(resize_image,channel); |
|---|
| 2528 | if ((traits == UndefinedPixelTrait) || |
|---|
| 2529 | (resize_traits == UndefinedPixelTrait)) |
|---|
| 2530 | continue; |
|---|
| 2531 | if ((resize_traits & CopyPixelTrait) != 0) |
|---|
| 2532 | { |
|---|
| 2533 | j=(ssize_t) (MagickMin(MagickMax(bisect,(double) start),(double) |
|---|
| 2534 | stop-1.0)+0.5); |
|---|
| 2535 | k=(ssize_t) ((contribution[j-start].pixel-contribution[0].pixel)* |
|---|
| 2536 | image->columns+x); |
|---|
| 2537 | SetPixelChannel(resize_image,channel,p[k*GetPixelChannels(image)+i], |
|---|
| 2538 | q); |
|---|
| 2539 | continue; |
|---|
| 2540 | } |
|---|
| 2541 | pixel=0.0; |
|---|
| 2542 | if ((resize_traits & BlendPixelTrait) == 0) |
|---|
| 2543 | { |
|---|
| 2544 | /* |
|---|
| 2545 | No alpha blending. |
|---|
| 2546 | */ |
|---|
| 2547 | for (j=0; j < n; j++) |
|---|
| 2548 | { |
|---|
| 2549 | k=(ssize_t) ((contribution[j].pixel-contribution[0].pixel)* |
|---|
| 2550 | image->columns+x); |
|---|
| 2551 | alpha=contribution[j].weight; |
|---|
| 2552 | pixel+=alpha*p[k*GetPixelChannels(image)+i]; |
|---|
| 2553 | } |
|---|
| 2554 | SetPixelChannel(resize_image,channel,ClampToQuantum(pixel),q); |
|---|
| 2555 | continue; |
|---|
| 2556 | } |
|---|
| 2557 | gamma=0.0; |
|---|
| 2558 | for (j=0; j < n; j++) |
|---|
| 2559 | { |
|---|
| 2560 | k=(ssize_t) ((contribution[j].pixel-contribution[0].pixel)* |
|---|
| 2561 | image->columns+x); |
|---|
| 2562 | alpha=contribution[j].weight*QuantumScale* |
|---|
| 2563 | GetPixelAlpha(image,p+k*GetPixelChannels(image)); |
|---|
| 2564 | pixel+=alpha*p[k*GetPixelChannels(image)+i]; |
|---|
| 2565 | gamma+=alpha; |
|---|
| 2566 | } |
|---|
| 2567 | gamma=1.0/(fabs((double) gamma) <= MagickEpsilon ? 1.0 : gamma); |
|---|
| 2568 | SetPixelChannel(resize_image,channel,ClampToQuantum(gamma*pixel),q); |
|---|
| 2569 | } |
|---|
| 2570 | q+=GetPixelChannels(resize_image); |
|---|
| 2571 | } |
|---|
| 2572 | if( IfMagickFalse(SyncCacheViewAuthenticPixels(resize_view,exception)) ) |
|---|
| 2573 | status=MagickFalse; |
|---|
| 2574 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
|---|
| 2575 | { |
|---|
| 2576 | MagickBooleanType |
|---|
| 2577 | proceed; |
|---|
| 2578 | |
|---|
| 2579 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
|---|
| 2580 | #pragma omp critical (MagickCore_VerticalFilter) |
|---|
| 2581 | #endif |
|---|
| 2582 | proceed=SetImageProgress(image,ResizeImageTag,(*offset)++,span); |
|---|
| 2583 | if( IfMagickFalse(proceed) ) |
|---|
| 2584 | status=MagickFalse; |
|---|
| 2585 | } |
|---|
| 2586 | } |
|---|
| 2587 | resize_view=DestroyCacheView(resize_view); |
|---|
| 2588 | image_view=DestroyCacheView(image_view); |
|---|
| 2589 | contributions=DestroyContributionThreadSet(contributions); |
|---|
| 2590 | return(status); |
|---|
| 2591 | } |
|---|
| 2592 | |
|---|
| 2593 | MagickExport Image *ResizeImage(const Image *image,const size_t columns, |
|---|
| 2594 | const size_t rows,const FilterTypes filter,ExceptionInfo *exception) |
|---|
| 2595 | { |
|---|
| 2596 | #define WorkLoadFactor 0.265 |
|---|
| 2597 | |
|---|
| 2598 | FilterTypes |
|---|
| 2599 | filter_type; |
|---|
| 2600 | |
|---|
| 2601 | Image |
|---|
| 2602 | *filter_image, |
|---|
| 2603 | *resize_image; |
|---|
| 2604 | |
|---|
| 2605 | MagickOffsetType |
|---|
| 2606 | offset; |
|---|
| 2607 | |
|---|
| 2608 | MagickRealType |
|---|
| 2609 | x_factor, |
|---|
| 2610 | y_factor; |
|---|
| 2611 | |
|---|
| 2612 | MagickSizeType |
|---|
| 2613 | span; |
|---|
| 2614 | |
|---|
| 2615 | MagickStatusType |
|---|
| 2616 | status; |
|---|
| 2617 | |
|---|
| 2618 | ResizeFilter |
|---|
| 2619 | *resize_filter; |
|---|
| 2620 | |
|---|
| 2621 | /* |
|---|
| 2622 | Acquire resize image. |
|---|
| 2623 | */ |
|---|
| 2624 | assert(image != (Image *) NULL); |
|---|
| 2625 | assert(image->signature == MagickSignature); |
|---|
| 2626 | if( IfMagickTrue(image->debug) ) |
|---|
| 2627 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
|---|
| 2628 | assert(exception != (ExceptionInfo *) NULL); |
|---|
| 2629 | assert(exception->signature == MagickSignature); |
|---|
| 2630 | if ((columns == 0) || (rows == 0)) |
|---|
| 2631 | ThrowImageException(ImageError,"NegativeOrZeroImageSize"); |
|---|
| 2632 | if ((columns == image->columns) && (rows == image->rows) && |
|---|
| 2633 | (filter == UndefinedFilter)) |
|---|
| 2634 | return(CloneImage(image,0,0,MagickTrue,exception)); |
|---|
| 2635 | resize_image=CloneImage(image,columns,rows,MagickTrue,exception); |
|---|
| 2636 | if (resize_image == (Image *) NULL) |
|---|
| 2637 | return(resize_image); |
|---|
| 2638 | /* |
|---|
| 2639 | Acquire resize filter. |
|---|
| 2640 | */ |
|---|
| 2641 | x_factor=(MagickRealType) columns/(MagickRealType) image->columns; |
|---|
| 2642 | y_factor=(MagickRealType) rows/(MagickRealType) image->rows; |
|---|
| 2643 | if ((x_factor*y_factor) > WorkLoadFactor) |
|---|
| 2644 | filter_image=CloneImage(image,columns,image->rows,MagickTrue,exception); |
|---|
| 2645 | else |
|---|
| 2646 | filter_image=CloneImage(image,image->columns,rows,MagickTrue,exception); |
|---|
| 2647 | if (filter_image == (Image *) NULL) |
|---|
| 2648 | return(DestroyImage(resize_image)); |
|---|
| 2649 | filter_type=LanczosFilter; |
|---|
| 2650 | if (filter != UndefinedFilter) |
|---|
| 2651 | filter_type=filter; |
|---|
| 2652 | else |
|---|
| 2653 | if ((x_factor == 1.0) && (y_factor == 1.0)) |
|---|
| 2654 | filter_type=PointFilter; |
|---|
| 2655 | else |
|---|
| 2656 | if ((image->storage_class == PseudoClass) || |
|---|
| 2657 | IfMagickTrue(image->matte) || |
|---|
| 2658 | ((x_factor*y_factor) > 1.0)) |
|---|
| 2659 | filter_type=MitchellFilter; |
|---|
| 2660 | resize_filter=AcquireResizeFilter(image,filter_type,MagickFalse,exception); |
|---|
| 2661 | /* |
|---|
| 2662 | Resize image. |
|---|
| 2663 | */ |
|---|
| 2664 | offset=0; |
|---|
| 2665 | if ((x_factor*y_factor) > WorkLoadFactor) |
|---|
| 2666 | { |
|---|
| 2667 | span=(MagickSizeType) (filter_image->columns+rows); |
|---|
| 2668 | status=HorizontalFilter(resize_filter,image,filter_image,x_factor,span, |
|---|
| 2669 | &offset,exception); |
|---|
| 2670 | status&=VerticalFilter(resize_filter,filter_image,resize_image,y_factor, |
|---|
| 2671 | span,&offset,exception); |
|---|
| 2672 | } |
|---|
| 2673 | else |
|---|
| 2674 | { |
|---|
| 2675 | span=(MagickSizeType) (filter_image->rows+columns); |
|---|
| 2676 | status=VerticalFilter(resize_filter,image,filter_image,y_factor,span, |
|---|
| 2677 | &offset,exception); |
|---|
| 2678 | status&=HorizontalFilter(resize_filter,filter_image,resize_image,x_factor, |
|---|
| 2679 | span,&offset,exception); |
|---|
| 2680 | } |
|---|
| 2681 | /* |
|---|
| 2682 | Free resources. |
|---|
| 2683 | */ |
|---|
| 2684 | filter_image=DestroyImage(filter_image); |
|---|
| 2685 | resize_filter=DestroyResizeFilter(resize_filter); |
|---|
| 2686 | if( IfMagickFalse(status) ) |
|---|
| 2687 | { |
|---|
| 2688 | resize_image=DestroyImage(resize_image); |
|---|
| 2689 | return((Image *) NULL); |
|---|
| 2690 | } |
|---|
| 2691 | resize_image->type=image->type; |
|---|
| 2692 | return(resize_image); |
|---|
| 2693 | } |
|---|
| 2694 | |
|---|
| 2695 | /* |
|---|
| 2696 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 2697 | % % |
|---|
| 2698 | % % |
|---|
| 2699 | % % |
|---|
| 2700 | % S a m p l e I m a g e % |
|---|
| 2701 | % % |
|---|
| 2702 | % % |
|---|
| 2703 | % % |
|---|
| 2704 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 2705 | % |
|---|
| 2706 | % SampleImage() scales an image to the desired dimensions with pixel |
|---|
| 2707 | % sampling. Unlike other scaling methods, this method does not introduce |
|---|
| 2708 | % any additional color into the scaled image. |
|---|
| 2709 | % |
|---|
| 2710 | % The format of the SampleImage method is: |
|---|
| 2711 | % |
|---|
| 2712 | % Image *SampleImage(const Image *image,const size_t columns, |
|---|
| 2713 | % const size_t rows,ExceptionInfo *exception) |
|---|
| 2714 | % |
|---|
| 2715 | % A description of each parameter follows: |
|---|
| 2716 | % |
|---|
| 2717 | % o image: the image. |
|---|
| 2718 | % |
|---|
| 2719 | % o columns: the number of columns in the sampled image. |
|---|
| 2720 | % |
|---|
| 2721 | % o rows: the number of rows in the sampled image. |
|---|
| 2722 | % |
|---|
| 2723 | % o exception: return any errors or warnings in this structure. |
|---|
| 2724 | % |
|---|
| 2725 | */ |
|---|
| 2726 | MagickExport Image *SampleImage(const Image *image,const size_t columns, |
|---|
| 2727 | const size_t rows,ExceptionInfo *exception) |
|---|
| 2728 | { |
|---|
| 2729 | #define SampleImageTag "Sample/Image" |
|---|
| 2730 | |
|---|
| 2731 | CacheView |
|---|
| 2732 | *image_view, |
|---|
| 2733 | *sample_view; |
|---|
| 2734 | |
|---|
| 2735 | Image |
|---|
| 2736 | *sample_image; |
|---|
| 2737 | |
|---|
| 2738 | MagickBooleanType |
|---|
| 2739 | status; |
|---|
| 2740 | |
|---|
| 2741 | MagickOffsetType |
|---|
| 2742 | progress; |
|---|
| 2743 | |
|---|
| 2744 | register ssize_t |
|---|
| 2745 | x; |
|---|
| 2746 | |
|---|
| 2747 | ssize_t |
|---|
| 2748 | *x_offset, |
|---|
| 2749 | y; |
|---|
| 2750 | |
|---|
| 2751 | /* |
|---|
| 2752 | Initialize sampled image attributes. |
|---|
| 2753 | */ |
|---|
| 2754 | assert(image != (const Image *) NULL); |
|---|
| 2755 | assert(image->signature == MagickSignature); |
|---|
| 2756 | if( IfMagickTrue(image->debug) ) |
|---|
| 2757 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
|---|
| 2758 | assert(exception != (ExceptionInfo *) NULL); |
|---|
| 2759 | assert(exception->signature == MagickSignature); |
|---|
| 2760 | if ((columns == 0) || (rows == 0)) |
|---|
| 2761 | ThrowImageException(ImageError,"NegativeOrZeroImageSize"); |
|---|
| 2762 | if ((columns == image->columns) && (rows == image->rows)) |
|---|
| 2763 | return(CloneImage(image,0,0,MagickTrue,exception)); |
|---|
| 2764 | sample_image=CloneImage(image,columns,rows,MagickTrue,exception); |
|---|
| 2765 | if (sample_image == (Image *) NULL) |
|---|
| 2766 | return((Image *) NULL); |
|---|
| 2767 | /* |
|---|
| 2768 | Allocate scan line buffer and column offset buffers. |
|---|
| 2769 | */ |
|---|
| 2770 | x_offset=(ssize_t *) AcquireQuantumMemory((size_t) sample_image->columns, |
|---|
| 2771 | sizeof(*x_offset)); |
|---|
| 2772 | if (x_offset == (ssize_t *) NULL) |
|---|
| 2773 | { |
|---|
| 2774 | sample_image=DestroyImage(sample_image); |
|---|
| 2775 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
|---|
| 2776 | } |
|---|
| 2777 | for (x=0; x < (ssize_t) sample_image->columns; x++) |
|---|
| 2778 | x_offset[x]=(ssize_t) (((MagickRealType) x+0.5)*image->columns/ |
|---|
| 2779 | sample_image->columns); |
|---|
| 2780 | /* |
|---|
| 2781 | Sample each row. |
|---|
| 2782 | */ |
|---|
| 2783 | status=MagickTrue; |
|---|
| 2784 | progress=0; |
|---|
| 2785 | image_view=AcquireVirtualCacheView(image,exception); |
|---|
| 2786 | sample_view=AcquireAuthenticCacheView(sample_image,exception); |
|---|
| 2787 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
|---|
| 2788 | #pragma omp parallel for schedule(static) shared(progress,status) \ |
|---|
| 2789 | dynamic_number_threads(image->columns,image->rows,1) |
|---|
| 2790 | #endif |
|---|
| 2791 | for (y=0; y < (ssize_t) sample_image->rows; y++) |
|---|
| 2792 | { |
|---|
| 2793 | register const Quantum |
|---|
| 2794 | *restrict p; |
|---|
| 2795 | |
|---|
| 2796 | register Quantum |
|---|
| 2797 | *restrict q; |
|---|
| 2798 | |
|---|
| 2799 | register ssize_t |
|---|
| 2800 | x; |
|---|
| 2801 | |
|---|
| 2802 | ssize_t |
|---|
| 2803 | y_offset; |
|---|
| 2804 | |
|---|
| 2805 | if( IfMagickFalse(status) ) |
|---|
| 2806 | continue; |
|---|
| 2807 | y_offset=(ssize_t) (((MagickRealType) y+0.5)*image->rows/ |
|---|
| 2808 | sample_image->rows); |
|---|
| 2809 | p=GetCacheViewVirtualPixels(image_view,0,y_offset,image->columns,1, |
|---|
| 2810 | exception); |
|---|
| 2811 | q=QueueCacheViewAuthenticPixels(sample_view,0,y,sample_image->columns,1, |
|---|
| 2812 | exception); |
|---|
| 2813 | if ((p == (const Quantum *) NULL) || (q == (Quantum *) NULL)) |
|---|
| 2814 | { |
|---|
| 2815 | status=MagickFalse; |
|---|
| 2816 | continue; |
|---|
| 2817 | } |
|---|
| 2818 | /* |
|---|
| 2819 | Sample each column. |
|---|
| 2820 | */ |
|---|
| 2821 | for (x=0; x < (ssize_t) sample_image->columns; x++) |
|---|
| 2822 | { |
|---|
| 2823 | register ssize_t |
|---|
| 2824 | i; |
|---|
| 2825 | |
|---|
| 2826 | if (GetPixelMask(sample_image,q) != 0) |
|---|
| 2827 | { |
|---|
| 2828 | q+=GetPixelChannels(sample_image); |
|---|
| 2829 | continue; |
|---|
| 2830 | } |
|---|
| 2831 | for (i=0; i < (ssize_t) GetPixelChannels(sample_image); i++) |
|---|
| 2832 | { |
|---|
| 2833 | PixelChannel |
|---|
| 2834 | channel; |
|---|
| 2835 | |
|---|
| 2836 | PixelTrait |
|---|
| 2837 | sample_traits, |
|---|
| 2838 | traits; |
|---|
| 2839 | |
|---|
| 2840 | channel=GetPixelChannelMapChannel(image,i); |
|---|
| 2841 | traits=GetPixelChannelMapTraits(image,channel); |
|---|
| 2842 | sample_traits=GetPixelChannelMapTraits(sample_image,channel); |
|---|
| 2843 | if ((traits == UndefinedPixelTrait) || |
|---|
| 2844 | (sample_traits == UndefinedPixelTrait)) |
|---|
| 2845 | continue; |
|---|
| 2846 | SetPixelChannel(sample_image,channel,p[x_offset[x]*GetPixelChannels( |
|---|
| 2847 | image)+i],q); |
|---|
| 2848 | } |
|---|
| 2849 | q+=GetPixelChannels(sample_image); |
|---|
| 2850 | } |
|---|
| 2851 | if( IfMagickFalse(SyncCacheViewAuthenticPixels(sample_view,exception)) ) |
|---|
| 2852 | status=MagickFalse; |
|---|
| 2853 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
|---|
| 2854 | { |
|---|
| 2855 | MagickBooleanType |
|---|
| 2856 | proceed; |
|---|
| 2857 | |
|---|
| 2858 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
|---|
| 2859 | #pragma omp critical (MagickCore_SampleImage) |
|---|
| 2860 | #endif |
|---|
| 2861 | proceed=SetImageProgress(image,SampleImageTag,progress++,image->rows); |
|---|
| 2862 | if( IfMagickFalse(proceed) ) |
|---|
| 2863 | status=MagickFalse; |
|---|
| 2864 | } |
|---|
| 2865 | } |
|---|
| 2866 | image_view=DestroyCacheView(image_view); |
|---|
| 2867 | sample_view=DestroyCacheView(sample_view); |
|---|
| 2868 | x_offset=(ssize_t *) RelinquishMagickMemory(x_offset); |
|---|
| 2869 | sample_image->type=image->type; |
|---|
| 2870 | return(sample_image); |
|---|
| 2871 | } |
|---|
| 2872 | |
|---|
| 2873 | /* |
|---|
| 2874 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 2875 | % % |
|---|
| 2876 | % % |
|---|
| 2877 | % % |
|---|
| 2878 | % S c a l e I m a g e % |
|---|
| 2879 | % % |
|---|
| 2880 | % % |
|---|
| 2881 | % % |
|---|
| 2882 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 2883 | % |
|---|
| 2884 | % ScaleImage() changes the size of an image to the given dimensions. |
|---|
| 2885 | % |
|---|
| 2886 | % The format of the ScaleImage method is: |
|---|
| 2887 | % |
|---|
| 2888 | % Image *ScaleImage(const Image *image,const size_t columns, |
|---|
| 2889 | % const size_t rows,ExceptionInfo *exception) |
|---|
| 2890 | % |
|---|
| 2891 | % A description of each parameter follows: |
|---|
| 2892 | % |
|---|
| 2893 | % o image: the image. |
|---|
| 2894 | % |
|---|
| 2895 | % o columns: the number of columns in the scaled image. |
|---|
| 2896 | % |
|---|
| 2897 | % o rows: the number of rows in the scaled image. |
|---|
| 2898 | % |
|---|
| 2899 | % o exception: return any errors or warnings in this structure. |
|---|
| 2900 | % |
|---|
| 2901 | */ |
|---|
| 2902 | MagickExport Image *ScaleImage(const Image *image,const size_t columns, |
|---|
| 2903 | const size_t rows,ExceptionInfo *exception) |
|---|
| 2904 | { |
|---|
| 2905 | #define ScaleImageTag "Scale/Image" |
|---|
| 2906 | |
|---|
| 2907 | CacheView |
|---|
| 2908 | *image_view, |
|---|
| 2909 | *scale_view; |
|---|
| 2910 | |
|---|
| 2911 | Image |
|---|
| 2912 | *scale_image; |
|---|
| 2913 | |
|---|
| 2914 | MagickBooleanType |
|---|
| 2915 | next_column, |
|---|
| 2916 | next_row, |
|---|
| 2917 | proceed; |
|---|
| 2918 | |
|---|
| 2919 | MagickRealType |
|---|
| 2920 | alpha, |
|---|
| 2921 | gamma, |
|---|
| 2922 | pixel[CompositePixelChannel], |
|---|
| 2923 | *scale_scanline, |
|---|
| 2924 | *scanline, |
|---|
| 2925 | *x_vector, |
|---|
| 2926 | *y_vector; |
|---|
| 2927 | |
|---|
| 2928 | PixelChannel |
|---|
| 2929 | channel; |
|---|
| 2930 | |
|---|
| 2931 | PixelTrait |
|---|
| 2932 | scale_traits, |
|---|
| 2933 | traits; |
|---|
| 2934 | |
|---|
| 2935 | PointInfo |
|---|
| 2936 | scale, |
|---|
| 2937 | span; |
|---|
| 2938 | |
|---|
| 2939 | register ssize_t |
|---|
| 2940 | i; |
|---|
| 2941 | |
|---|
| 2942 | ssize_t |
|---|
| 2943 | n, |
|---|
| 2944 | number_rows, |
|---|
| 2945 | y; |
|---|
| 2946 | |
|---|
| 2947 | /* |
|---|
| 2948 | Initialize scaled image attributes. |
|---|
| 2949 | */ |
|---|
| 2950 | assert(image != (const Image *) NULL); |
|---|
| 2951 | assert(image->signature == MagickSignature); |
|---|
| 2952 | if( IfMagickTrue(image->debug) ) |
|---|
| 2953 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
|---|
| 2954 | assert(exception != (ExceptionInfo *) NULL); |
|---|
| 2955 | assert(exception->signature == MagickSignature); |
|---|
| 2956 | if ((columns == 0) || (rows == 0)) |
|---|
| 2957 | return((Image *) NULL); |
|---|
| 2958 | if ((columns == image->columns) && (rows == image->rows)) |
|---|
| 2959 | return(CloneImage(image,0,0,MagickTrue,exception)); |
|---|
| 2960 | scale_image=CloneImage(image,columns,rows,MagickTrue,exception); |
|---|
| 2961 | if (scale_image == (Image *) NULL) |
|---|
| 2962 | return((Image *) NULL); |
|---|
| 2963 | if( IfMagickFalse(SetImageStorageClass(scale_image,DirectClass,exception)) ) |
|---|
| 2964 | { |
|---|
| 2965 | scale_image=DestroyImage(scale_image); |
|---|
| 2966 | return((Image *) NULL); |
|---|
| 2967 | } |
|---|
| 2968 | /* |
|---|
| 2969 | Allocate memory. |
|---|
| 2970 | */ |
|---|
| 2971 | x_vector=(MagickRealType *) AcquireQuantumMemory((size_t) image->columns, |
|---|
| 2972 | GetPixelChannels(image)*sizeof(*x_vector)); |
|---|
| 2973 | scanline=x_vector; |
|---|
| 2974 | if (image->rows != scale_image->rows) |
|---|
| 2975 | scanline=(MagickRealType *) AcquireQuantumMemory((size_t) image->columns, |
|---|
| 2976 | GetPixelChannels(image)*sizeof(*scanline)); |
|---|
| 2977 | scale_scanline=(MagickRealType *) AcquireQuantumMemory((size_t) |
|---|
| 2978 | scale_image->columns,MaxPixelChannels*sizeof(*scale_scanline)); |
|---|
| 2979 | y_vector=(MagickRealType *) AcquireQuantumMemory((size_t) image->columns, |
|---|
| 2980 | GetPixelChannels(image)*sizeof(*y_vector)); |
|---|
| 2981 | if ((scanline == (MagickRealType *) NULL) || |
|---|
| 2982 | (scale_scanline == (MagickRealType *) NULL) || |
|---|
| 2983 | (x_vector == (MagickRealType *) NULL) || |
|---|
| 2984 | (y_vector == (MagickRealType *) NULL)) |
|---|
| 2985 | { |
|---|
| 2986 | scale_image=DestroyImage(scale_image); |
|---|
| 2987 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
|---|
| 2988 | } |
|---|
| 2989 | /* |
|---|
| 2990 | Scale image. |
|---|
| 2991 | */ |
|---|
| 2992 | number_rows=0; |
|---|
| 2993 | next_row=MagickTrue; |
|---|
| 2994 | span.y=1.0; |
|---|
| 2995 | scale.y=(double) scale_image->rows/(double) image->rows; |
|---|
| 2996 | for (i=0; i < (ssize_t) (GetPixelChannels(image)*image->columns); i++) |
|---|
| 2997 | y_vector[i]=0.0; |
|---|
| 2998 | n=0; |
|---|
| 2999 | image_view=AcquireVirtualCacheView(image,exception); |
|---|
| 3000 | scale_view=AcquireAuthenticCacheView(scale_image,exception); |
|---|
| 3001 | for (y=0; y < (ssize_t) scale_image->rows; y++) |
|---|
| 3002 | { |
|---|
| 3003 | register const Quantum |
|---|
| 3004 | *restrict p; |
|---|
| 3005 | |
|---|
| 3006 | register Quantum |
|---|
| 3007 | *restrict q; |
|---|
| 3008 | |
|---|
| 3009 | register ssize_t |
|---|
| 3010 | x; |
|---|
| 3011 | |
|---|
| 3012 | q=QueueCacheViewAuthenticPixels(scale_view,0,y,scale_image->columns,1, |
|---|
| 3013 | exception); |
|---|
| 3014 | if (q == (Quantum *) NULL) |
|---|
| 3015 | break; |
|---|
| 3016 | alpha=1.0; |
|---|
| 3017 | if (scale_image->rows == image->rows) |
|---|
| 3018 | { |
|---|
| 3019 | /* |
|---|
| 3020 | Read a new scanline. |
|---|
| 3021 | */ |
|---|
| 3022 | p=GetCacheViewVirtualPixels(image_view,0,n++,image->columns,1, |
|---|
| 3023 | exception); |
|---|
| 3024 | if (p == (const Quantum *) NULL) |
|---|
| 3025 | break; |
|---|
| 3026 | for (x=0; x < (ssize_t) image->columns; x++) |
|---|
| 3027 | { |
|---|
| 3028 | if (GetPixelMask(image,p) != 0) |
|---|
| 3029 | { |
|---|
| 3030 | p+=GetPixelChannels(image); |
|---|
| 3031 | continue; |
|---|
| 3032 | } |
|---|
| 3033 | for (i=0; i < (ssize_t) GetPixelChannels(image); i++) |
|---|
| 3034 | { |
|---|
| 3035 | PixelChannel |
|---|
| 3036 | channel; |
|---|
| 3037 | |
|---|
| 3038 | PixelTrait |
|---|
| 3039 | traits; |
|---|
| 3040 | |
|---|
| 3041 | channel=GetPixelChannelMapChannel(image,i); |
|---|
| 3042 | traits=GetPixelChannelMapTraits(image,channel); |
|---|
| 3043 | if ((traits & BlendPixelTrait) == 0) |
|---|
| 3044 | { |
|---|
| 3045 | x_vector[x*GetPixelChannels(image)+i]=(MagickRealType) p[i]; |
|---|
| 3046 | continue; |
|---|
| 3047 | } |
|---|
| 3048 | alpha=QuantumScale*GetPixelAlpha(image,p); |
|---|
| 3049 | x_vector[x*GetPixelChannels(image)+i]=alpha*p[i]; |
|---|
| 3050 | } |
|---|
| 3051 | p+=GetPixelChannels(image); |
|---|
| 3052 | } |
|---|
| 3053 | } |
|---|
| 3054 | else |
|---|
| 3055 | { |
|---|
| 3056 | /* |
|---|
| 3057 | Scale Y direction. |
|---|
| 3058 | */ |
|---|
| 3059 | while (scale.y < span.y) |
|---|
| 3060 | { |
|---|
| 3061 | if( IfMagickTrue(next_row) && (number_rows < (ssize_t) image->rows)) |
|---|
| 3062 | { |
|---|
| 3063 | /* |
|---|
| 3064 | Read a new scanline. |
|---|
| 3065 | */ |
|---|
| 3066 | p=GetCacheViewVirtualPixels(image_view,0,n++,image->columns,1, |
|---|
| 3067 | exception); |
|---|
| 3068 | if (p == (const Quantum *) NULL) |
|---|
| 3069 | break; |
|---|
| 3070 | for (x=0; x < (ssize_t) image->columns; x++) |
|---|
| 3071 | { |
|---|
| 3072 | if (GetPixelMask(image,p) != 0) |
|---|
| 3073 | { |
|---|
| 3074 | p+=GetPixelChannels(image); |
|---|
| 3075 | continue; |
|---|
| 3076 | } |
|---|
| 3077 | for (i=0; i < (ssize_t) GetPixelChannels(image); i++) |
|---|
| 3078 | { |
|---|
| 3079 | PixelChannel |
|---|
| 3080 | channel; |
|---|
| 3081 | |
|---|
| 3082 | PixelTrait |
|---|
| 3083 | traits; |
|---|
| 3084 | |
|---|
| 3085 | channel=GetPixelChannelMapChannel(image,i); |
|---|
| 3086 | traits=GetPixelChannelMapTraits(image,channel); |
|---|
| 3087 | if ((traits & BlendPixelTrait) == 0) |
|---|
| 3088 | { |
|---|
| 3089 | x_vector[x*GetPixelChannels(image)+i]=(MagickRealType) |
|---|
| 3090 | p[i]; |
|---|
| 3091 | continue; |
|---|
| 3092 | } |
|---|
| 3093 | alpha=QuantumScale*GetPixelAlpha(image,p); |
|---|
| 3094 | x_vector[x*GetPixelChannels(image)+i]=alpha*p[i]; |
|---|
| 3095 | } |
|---|
| 3096 | p+=GetPixelChannels(image); |
|---|
| 3097 | } |
|---|
| 3098 | number_rows++; |
|---|
| 3099 | } |
|---|
| 3100 | for (x=0; x < (ssize_t) image->columns; x++) |
|---|
| 3101 | for (i=0; i < (ssize_t) GetPixelChannels(image); i++) |
|---|
| 3102 | y_vector[x*GetPixelChannels(image)+i]+=scale.y* |
|---|
| 3103 | x_vector[x*GetPixelChannels(image)+i]; |
|---|
| 3104 | span.y-=scale.y; |
|---|
| 3105 | scale.y=(double) scale_image->rows/(double) image->rows; |
|---|
| 3106 | next_row=MagickTrue; |
|---|
| 3107 | } |
|---|
| 3108 | if( IfMagickTrue(next_row) && (number_rows < (ssize_t) image->rows)) |
|---|
| 3109 | { |
|---|
| 3110 | /* |
|---|
| 3111 | Read a new scanline. |
|---|
| 3112 | */ |
|---|
| 3113 | p=GetCacheViewVirtualPixels(image_view,0,n++,image->columns,1, |
|---|
| 3114 | exception); |
|---|
| 3115 | if (p == (const Quantum *) NULL) |
|---|
| 3116 | break; |
|---|
| 3117 | for (x=0; x < (ssize_t) image->columns; x++) |
|---|
| 3118 | { |
|---|
| 3119 | if (GetPixelMask(image,p) != 0) |
|---|
| 3120 | { |
|---|
| 3121 | p+=GetPixelChannels(image); |
|---|
| 3122 | continue; |
|---|
| 3123 | } |
|---|
| 3124 | for (i=0; i < (ssize_t) GetPixelChannels(image); i++) |
|---|
| 3125 | { |
|---|
| 3126 | PixelChannel |
|---|
| 3127 | channel; |
|---|
| 3128 | |
|---|
| 3129 | PixelTrait |
|---|
| 3130 | traits; |
|---|
| 3131 | |
|---|
| 3132 | channel=GetPixelChannelMapChannel(image,i); |
|---|
| 3133 | traits=GetPixelChannelMapTraits(image,channel); |
|---|
| 3134 | if ((traits & BlendPixelTrait) == 0) |
|---|
| 3135 | { |
|---|
| 3136 | x_vector[x*GetPixelChannels(image)+i]=(MagickRealType) |
|---|
| 3137 | p[i]; |
|---|
| 3138 | continue; |
|---|
| 3139 | } |
|---|
| 3140 | alpha=QuantumScale*GetPixelAlpha(image,p); |
|---|
| 3141 | x_vector[x*GetPixelChannels(image)+i]=alpha*p[i]; |
|---|
| 3142 | } |
|---|
| 3143 | p+=GetPixelChannels(image); |
|---|
| 3144 | } |
|---|
| 3145 | number_rows++; |
|---|
| 3146 | next_row=MagickFalse; |
|---|
| 3147 | } |
|---|
| 3148 | for (x=0; x < (ssize_t) image->columns; x++) |
|---|
| 3149 | { |
|---|
| 3150 | for (i=0; i < (ssize_t) GetPixelChannels(image); i++) |
|---|
| 3151 | { |
|---|
| 3152 | pixel[i]=y_vector[x*GetPixelChannels(image)+i]+span.y* |
|---|
| 3153 | x_vector[x*GetPixelChannels(image)+i]; |
|---|
| 3154 | scanline[x*GetPixelChannels(image)+i]=pixel[i]; |
|---|
| 3155 | y_vector[x*GetPixelChannels(image)+i]=0.0; |
|---|
| 3156 | } |
|---|
| 3157 | } |
|---|
| 3158 | scale.y-=span.y; |
|---|
| 3159 | if (scale.y <= 0) |
|---|
| 3160 | { |
|---|
| 3161 | scale.y=(double) scale_image->rows/(double) image->rows; |
|---|
| 3162 | next_row=MagickTrue; |
|---|
| 3163 | } |
|---|
| 3164 | span.y=1.0; |
|---|
| 3165 | } |
|---|
| 3166 | if (scale_image->columns == image->columns) |
|---|
| 3167 | { |
|---|
| 3168 | /* |
|---|
| 3169 | Transfer scanline to scaled image. |
|---|
| 3170 | */ |
|---|
| 3171 | for (x=0; x < (ssize_t) scale_image->columns; x++) |
|---|
| 3172 | { |
|---|
| 3173 | if (GetPixelMask(scale_image,q) != 0) |
|---|
| 3174 | { |
|---|
| 3175 | q+=GetPixelChannels(scale_image); |
|---|
| 3176 | continue; |
|---|
| 3177 | } |
|---|
| 3178 | for (i=0; i < (ssize_t) GetPixelChannels(scale_image); i++) |
|---|
| 3179 | { |
|---|
| 3180 | ssize_t |
|---|
| 3181 | offset; |
|---|
| 3182 | |
|---|
| 3183 | channel=GetPixelChannelMapChannel(scale_image,i); |
|---|
| 3184 | traits=GetPixelChannelMapTraits(image,channel); |
|---|
| 3185 | scale_traits=GetPixelChannelMapTraits(scale_image,channel); |
|---|
| 3186 | if ((traits == UndefinedPixelTrait) || |
|---|
| 3187 | (scale_traits == UndefinedPixelTrait)) |
|---|
| 3188 | continue; |
|---|
| 3189 | offset=GetPixelChannelMapOffset(image,channel); |
|---|
| 3190 | if ((traits & BlendPixelTrait) == 0) |
|---|
| 3191 | { |
|---|
| 3192 | SetPixelChannel(scale_image,channel,ClampToQuantum( |
|---|
| 3193 | scanline[x*GetPixelChannels(image)+offset]),q); |
|---|
| 3194 | continue; |
|---|
| 3195 | } |
|---|
| 3196 | alpha=QuantumScale*scanline[x*GetPixelChannels(image)+ |
|---|
| 3197 | GetPixelChannelMapChannel(image,AlphaPixelChannel)]; |
|---|
| 3198 | gamma=1.0/(fabs((double) alpha) <= MagickEpsilon ? 1.0 : alpha); |
|---|
| 3199 | SetPixelChannel(scale_image,channel,ClampToQuantum(gamma*scanline[ |
|---|
| 3200 | x*GetPixelChannels(image)+offset]),q); |
|---|
| 3201 | } |
|---|
| 3202 | q+=GetPixelChannels(scale_image); |
|---|
| 3203 | } |
|---|
| 3204 | } |
|---|
| 3205 | else |
|---|
| 3206 | { |
|---|
| 3207 | ssize_t |
|---|
| 3208 | n; |
|---|
| 3209 | |
|---|
| 3210 | /* |
|---|
| 3211 | Scale X direction. |
|---|
| 3212 | */ |
|---|
| 3213 | next_column=MagickFalse; |
|---|
| 3214 | n=0; |
|---|
| 3215 | span.x=1.0; |
|---|
| 3216 | for (i=0; i < (ssize_t) GetPixelChannels(image); i++) |
|---|
| 3217 | pixel[i]=0.0; |
|---|
| 3218 | for (x=0; x < (ssize_t) image->columns; x++) |
|---|
| 3219 | { |
|---|
| 3220 | scale.x=(double) scale_image->columns/(double) image->columns; |
|---|
| 3221 | while (scale.x >= span.x) |
|---|
| 3222 | { |
|---|
| 3223 | if( IfMagickTrue(next_column) ) |
|---|
| 3224 | { |
|---|
| 3225 | for (i=0; i < (ssize_t) GetPixelChannels(image); i++) |
|---|
| 3226 | pixel[i]=0.0; |
|---|
| 3227 | n++; |
|---|
| 3228 | } |
|---|
| 3229 | for (i=0; i < (ssize_t) GetPixelChannels(image); i++) |
|---|
| 3230 | { |
|---|
| 3231 | PixelChannel |
|---|
| 3232 | channel; |
|---|
| 3233 | |
|---|
| 3234 | PixelTrait |
|---|
| 3235 | traits; |
|---|
| 3236 | |
|---|
| 3237 | channel=GetPixelChannelMapChannel(image,i); |
|---|
| 3238 | traits=GetPixelChannelMapTraits(image,channel); |
|---|
| 3239 | if (traits == UndefinedPixelTrait) |
|---|
| 3240 | continue; |
|---|
| 3241 | pixel[i]+=span.x*scanline[x*GetPixelChannels(image)+i]; |
|---|
| 3242 | scale_scanline[n*MaxPixelChannels+channel]=pixel[i]; |
|---|
| 3243 | } |
|---|
| 3244 | scale.x-=span.x; |
|---|
| 3245 | span.x=1.0; |
|---|
| 3246 | next_column=MagickTrue; |
|---|
| 3247 | } |
|---|
| 3248 | if (scale.x > 0) |
|---|
| 3249 | { |
|---|
| 3250 | if( IfMagickTrue(next_column) ) |
|---|
| 3251 | { |
|---|
| 3252 | for (i=0; i < (ssize_t) GetPixelChannels(image); i++) |
|---|
| 3253 | pixel[i]=0.0; |
|---|
| 3254 | n++; |
|---|
| 3255 | next_column=MagickFalse; |
|---|
| 3256 | } |
|---|
| 3257 | for (i=0; i < (ssize_t) GetPixelChannels(image); i++) |
|---|
| 3258 | pixel[i]+=scale.x*scanline[x*GetPixelChannels(image)+i]; |
|---|
| 3259 | span.x-=scale.x; |
|---|
| 3260 | } |
|---|
| 3261 | } |
|---|
| 3262 | if (span.x > 0) |
|---|
| 3263 | { |
|---|
| 3264 | for (i=0; i < (ssize_t) GetPixelChannels(image); i++) |
|---|
| 3265 | pixel[i]+=span.x*scanline[(x-1)*GetPixelChannels(image)+i]; |
|---|
| 3266 | } |
|---|
| 3267 | if( IfMagickFalse(next_column) && |
|---|
| 3268 | ((ssize_t) n < (ssize_t) scale_image->columns)) |
|---|
| 3269 | for (i=0; i < (ssize_t) GetPixelChannels(image); i++) |
|---|
| 3270 | { |
|---|
| 3271 | channel=GetPixelChannelMapChannel(image,i); |
|---|
| 3272 | scale_scanline[n*MaxPixelChannels+channel]=pixel[i]; |
|---|
| 3273 | } |
|---|
| 3274 | /* |
|---|
| 3275 | Transfer scanline to scaled image. |
|---|
| 3276 | */ |
|---|
| 3277 | for (x=0; x < (ssize_t) scale_image->columns; x++) |
|---|
| 3278 | { |
|---|
| 3279 | if (GetPixelMask(scale_image,q) != 0) |
|---|
| 3280 | { |
|---|
| 3281 | q+=GetPixelChannels(scale_image); |
|---|
| 3282 | continue; |
|---|
| 3283 | } |
|---|
| 3284 | for (i=0; i < (ssize_t) GetPixelChannels(scale_image); i++) |
|---|
| 3285 | { |
|---|
| 3286 | channel=GetPixelChannelMapChannel(scale_image,i); |
|---|
| 3287 | traits=GetPixelChannelMapTraits(image,channel); |
|---|
| 3288 | scale_traits=GetPixelChannelMapTraits(scale_image,channel); |
|---|
| 3289 | if ((traits == UndefinedPixelTrait) || |
|---|
| 3290 | (scale_traits == UndefinedPixelTrait)) |
|---|
| 3291 | continue; |
|---|
| 3292 | if ((traits & BlendPixelTrait) == 0) |
|---|
| 3293 | { |
|---|
| 3294 | SetPixelChannel(scale_image,channel,ClampToQuantum( |
|---|
| 3295 | scale_scanline[x*MaxPixelChannels+channel]),q); |
|---|
| 3296 | continue; |
|---|
| 3297 | } |
|---|
| 3298 | alpha=QuantumScale*scanline[x*GetPixelChannels(image)+ |
|---|
| 3299 | GetPixelChannelMapChannel(image,AlphaPixelChannel)]; |
|---|
| 3300 | gamma=1.0/(fabs((double) alpha) <= MagickEpsilon ? 1.0 : alpha); |
|---|
| 3301 | SetPixelChannel(scale_image,channel,ClampToQuantum(gamma* |
|---|
| 3302 | scale_scanline[x*MaxPixelChannels+channel]),q); |
|---|
| 3303 | } |
|---|
| 3304 | q+=GetPixelChannels(scale_image); |
|---|
| 3305 | } |
|---|
| 3306 | } |
|---|
| 3307 | if( IfMagickFalse(SyncCacheViewAuthenticPixels(scale_view,exception)) ) |
|---|
| 3308 | break; |
|---|
| 3309 | proceed=SetImageProgress(image,ScaleImageTag,(MagickOffsetType) y, |
|---|
| 3310 | image->rows); |
|---|
| 3311 | if( IfMagickFalse(proceed) ) |
|---|
| 3312 | break; |
|---|
| 3313 | } |
|---|
| 3314 | scale_view=DestroyCacheView(scale_view); |
|---|
| 3315 | image_view=DestroyCacheView(image_view); |
|---|
| 3316 | /* |
|---|
| 3317 | Free allocated memory. |
|---|
| 3318 | */ |
|---|
| 3319 | y_vector=(MagickRealType *) RelinquishMagickMemory(y_vector); |
|---|
| 3320 | scale_scanline=(MagickRealType *) RelinquishMagickMemory(scale_scanline); |
|---|
| 3321 | if (scale_image->rows != image->rows) |
|---|
| 3322 | scanline=(MagickRealType *) RelinquishMagickMemory(scanline); |
|---|
| 3323 | x_vector=(MagickRealType *) RelinquishMagickMemory(x_vector); |
|---|
| 3324 | scale_image->type=image->type; |
|---|
| 3325 | return(scale_image); |
|---|
| 3326 | } |
|---|
| 3327 | |
|---|
| 3328 | /* |
|---|
| 3329 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 3330 | % % |
|---|
| 3331 | % % |
|---|
| 3332 | % % |
|---|
| 3333 | % T h u m b n a i l I m a g e % |
|---|
| 3334 | % % |
|---|
| 3335 | % % |
|---|
| 3336 | % % |
|---|
| 3337 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
|---|
| 3338 | % |
|---|
| 3339 | % ThumbnailImage() changes the size of an image to the given dimensions and |
|---|
| 3340 | % removes any associated profiles. The goal is to produce small low cost |
|---|
| 3341 | % thumbnail images suited for display on the Web. |
|---|
| 3342 | % |
|---|
| 3343 | % The format of the ThumbnailImage method is: |
|---|
| 3344 | % |
|---|
| 3345 | % Image *ThumbnailImage(const Image *image,const size_t columns, |
|---|
| 3346 | % const size_t rows,ExceptionInfo *exception) |
|---|
| 3347 | % |
|---|
| 3348 | % A description of each parameter follows: |
|---|
| 3349 | % |
|---|
| 3350 | % o image: the image. |
|---|
| 3351 | % |
|---|
| 3352 | % o columns: the number of columns in the scaled image. |
|---|
| 3353 | % |
|---|
| 3354 | % o rows: the number of rows in the scaled image. |
|---|
| 3355 | % |
|---|
| 3356 | % o exception: return any errors or warnings in this structure. |
|---|
| 3357 | % |
|---|
| 3358 | */ |
|---|
| 3359 | MagickExport Image *ThumbnailImage(const Image *image,const size_t columns, |
|---|
| 3360 | const size_t rows,ExceptionInfo *exception) |
|---|
| 3361 | { |
|---|
| 3362 | #define SampleFactor 5 |
|---|
| 3363 | |
|---|
| 3364 | char |
|---|
| 3365 | value[MaxTextExtent]; |
|---|
| 3366 | |
|---|
| 3367 | const char |
|---|
| 3368 | *name; |
|---|
| 3369 | |
|---|
| 3370 | Image |
|---|
| 3371 | *thumbnail_image; |
|---|
| 3372 | |
|---|
| 3373 | MagickRealType |
|---|
| 3374 | x_factor, |
|---|
| 3375 | y_factor; |
|---|
| 3376 | |
|---|
| 3377 | size_t |
|---|
| 3378 | version; |
|---|
| 3379 | |
|---|
| 3380 | struct stat |
|---|
| 3381 | attributes; |
|---|
| 3382 | |
|---|
| 3383 | assert(image != (Image *) NULL); |
|---|
| 3384 | assert(image->signature == MagickSignature); |
|---|
| 3385 | if( IfMagickTrue(image->debug) ) |
|---|
| 3386 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
|---|
| 3387 | assert(exception != (ExceptionInfo *) NULL); |
|---|
| 3388 | assert(exception->signature == MagickSignature); |
|---|
| 3389 | x_factor=(MagickRealType) columns/(MagickRealType) image->columns; |
|---|
| 3390 | y_factor=(MagickRealType) rows/(MagickRealType) image->rows; |
|---|
| 3391 | if ((x_factor*y_factor) > 0.1) |
|---|
| 3392 | thumbnail_image=ResizeImage(image,columns,rows,image->filter,exception); |
|---|
| 3393 | else |
|---|
| 3394 | if (((SampleFactor*columns) < 128) || ((SampleFactor*rows) < 128)) |
|---|
| 3395 | thumbnail_image=ResizeImage(image,columns,rows,image->filter,exception); |
|---|
| 3396 | else |
|---|
| 3397 | { |
|---|
| 3398 | Image |
|---|
| 3399 | *sample_image; |
|---|
| 3400 | |
|---|
| 3401 | sample_image=SampleImage(image,SampleFactor*columns,SampleFactor*rows, |
|---|
| 3402 | exception); |
|---|
| 3403 | if (sample_image == (Image *) NULL) |
|---|
| 3404 | return((Image *) NULL); |
|---|
| 3405 | thumbnail_image=ResizeImage(sample_image,columns,rows,image->filter, |
|---|
| 3406 | exception); |
|---|
| 3407 | sample_image=DestroyImage(sample_image); |
|---|
| 3408 | } |
|---|
| 3409 | if (thumbnail_image == (Image *) NULL) |
|---|
| 3410 | return(thumbnail_image); |
|---|
| 3411 | (void) ParseAbsoluteGeometry("0x0+0+0",&thumbnail_image->page); |
|---|
| 3412 | if( IfMagickFalse(thumbnail_image->matte) ) |
|---|
| 3413 | (void) SetImageAlphaChannel(thumbnail_image,OpaqueAlphaChannel,exception); |
|---|
| 3414 | thumbnail_image->depth=8; |
|---|
| 3415 | thumbnail_image->interlace=NoInterlace; |
|---|
| 3416 | /* |
|---|
| 3417 | Strip all profiles except color profiles. |
|---|
| 3418 | */ |
|---|
| 3419 | ResetImageProfileIterator(thumbnail_image); |
|---|
| 3420 | for (name=GetNextImageProfile(thumbnail_image); name != (const char *) NULL; ) |
|---|
| 3421 | { |
|---|
| 3422 | if ((LocaleCompare(name,"icc") != 0) && (LocaleCompare(name,"icm") != 0)) |
|---|
| 3423 | { |
|---|
| 3424 | (void) DeleteImageProfile(thumbnail_image,name); |
|---|
| 3425 | ResetImageProfileIterator(thumbnail_image); |
|---|
| 3426 | } |
|---|
| 3427 | name=GetNextImageProfile(thumbnail_image); |
|---|
| 3428 | } |
|---|
| 3429 | (void) DeleteImageProperty(thumbnail_image,"comment"); |
|---|
| 3430 | (void) CopyMagickString(value,image->magick_filename,MaxTextExtent); |
|---|
| 3431 | if (strstr(image->magick_filename,"//") == (char *) NULL) |
|---|
| 3432 | (void) FormatLocaleString(value,MaxTextExtent,"file://%s", |
|---|
| 3433 | image->magick_filename); |
|---|
| 3434 | (void) SetImageProperty(thumbnail_image,"Thumb::URI",value,exception); |
|---|
| 3435 | (void) CopyMagickString(value,image->magick_filename,MaxTextExtent); |
|---|
| 3436 | if( IfMagickTrue(GetPathAttributes(image->filename,&attributes)) ) |
|---|
| 3437 | { |
|---|
| 3438 | (void) FormatLocaleString(value,MaxTextExtent,"%.20g",(double) |
|---|
| 3439 | attributes.st_mtime); |
|---|
| 3440 | (void) SetImageProperty(thumbnail_image,"Thumb::MTime",value,exception); |
|---|
| 3441 | } |
|---|
| 3442 | (void) FormatLocaleString(value,MaxTextExtent,"%.20g",(double) |
|---|
| 3443 | attributes.st_mtime); |
|---|
| 3444 | (void) FormatMagickSize(GetBlobSize(image),MagickFalse,value); |
|---|
| 3445 | (void) ConcatenateMagickString(value,"B",MaxTextExtent); |
|---|
| 3446 | (void) SetImageProperty(thumbnail_image,"Thumb::Size",value,exception); |
|---|
| 3447 | (void) FormatLocaleString(value,MaxTextExtent,"image/%s",image->magick); |
|---|
| 3448 | LocaleLower(value); |
|---|
| 3449 | (void) SetImageProperty(thumbnail_image,"Thumb::Mimetype",value,exception); |
|---|
| 3450 | (void) SetImageProperty(thumbnail_image,"software",GetMagickVersion(&version), |
|---|
| 3451 | exception); |
|---|
| 3452 | (void) FormatLocaleString(value,MaxTextExtent,"%.20g",(double) |
|---|
| 3453 | image->magick_columns); |
|---|
| 3454 | (void) SetImageProperty(thumbnail_image,"Thumb::Image::Width",value, |
|---|
| 3455 | exception); |
|---|
| 3456 | (void) FormatLocaleString(value,MaxTextExtent,"%.20g",(double) |
|---|
| 3457 | image->magick_rows); |
|---|
| 3458 | (void) SetImageProperty(thumbnail_image,"Thumb::Image::Height",value, |
|---|
| 3459 | exception); |
|---|
| 3460 | (void) FormatLocaleString(value,MaxTextExtent,"%.20g",(double) |
|---|
| 3461 | GetImageListLength(image)); |
|---|
| 3462 | (void) SetImageProperty(thumbnail_image,"Thumb::Document::Pages",value, |
|---|
| 3463 | exception); |
|---|
| 3464 | return(thumbnail_image); |
|---|
| 3465 | } |
|---|